CAS 58446-29-0
:3-carboxy-2',4'-difluorobiphenyl-4-yl beta-D-glucopyranosiduronic acid
Description:
3-Carboxy-2',4'-difluorobiphenyl-4-yl beta-D-glucopyranosiduronic acid, with the CAS number 58446-29-0, is a complex organic compound characterized by its unique structural features. It consists of a biphenyl core substituted with two fluorine atoms at the 2' and 4' positions, and a carboxylic acid group at the 3-position, which contributes to its acidity and potential reactivity. The compound also contains a beta-D-glucopyranosiduronic acid moiety, indicating that it is a glycoside, which may influence its solubility and biological activity. The presence of the glucuronic acid component suggests potential applications in biochemistry, particularly in drug metabolism and detoxification processes, as glucuronidation is a common phase II metabolic reaction. The difluorobiphenyl structure may impart specific electronic and steric properties, making it of interest in materials science and medicinal chemistry. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a subject of interest for further research in various chemical and biological contexts.
Formula:C19H16F2O9
InChI:InChI=1/C19H16F2O9/c20-8-2-3-9(11(21)6-8)7-1-4-12(10(5-7)17(25)26)29-19-15(24)13(22)14(23)16(30-19)18(27)28/h1-6,13-16,19,22-24H,(H,25,26)(H,27,28)/t13-,14-,15+,16-,19+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Diflunisal Phenolic Glucuronide Lithium Salt
CAS:Formula:C19H14F2O9·2LiColor and Shape:White To Off-White SolidMolecular weight:424.31 2 6.94Diflunisal 1-O-β-D-Glucuronide
CAS:Controlled ProductFormula:C19H16F2O9Color and Shape:NeatMolecular weight:426.322

