CAS 58446-30-3
:1-O-[(2',4'-difluoro-4-hydroxybiphenyl-3-yl)carbonyl]-beta-D-glucopyranuronic acid
Description:
1-O-[(2',4'-difluoro-4-hydroxybiphenyl-3-yl)carbonyl]-beta-D-glucopyranuronic acid, with CAS number 58446-30-3, is a chemical compound characterized by its complex structure, which includes a glucopyranuronic acid moiety linked to a biphenyl derivative. The presence of the difluoro and hydroxy groups on the biphenyl ring suggests that the compound may exhibit unique electronic and steric properties, potentially influencing its reactivity and interactions with biological systems. The carbonyl group in the structure indicates that it may participate in various chemical reactions, such as nucleophilic attacks or hydrogen bonding. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity stemming from the biphenyl component. Additionally, the glucopyranuronic acid part may contribute to solubility and bioavailability, making it a candidate for further research in drug formulation and delivery systems. Overall, the compound's characteristics suggest a multifaceted role in chemical and biological applications.
Formula:C19H16F2O9
InChI:InChI=1/C19H16F2O9/c20-8-2-3-9(11(21)6-8)7-1-4-12(22)10(5-7)18(28)30-19-15(25)13(23)14(24)16(29-19)17(26)27/h1-6,13-16,19,22-25H,(H,26,27)/t13-,14-,15+,16-,19-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diflunisal Acyl Glucuronide
CAS:Formula:C19H16F2O9Color and Shape:White To Off-White SolidMolecular weight:426.33Diflunisal-acyl-β-D-glucuronide
CAS:Diflunisal-acyl-β-D-glucuronidePurity:>95%Molecular weight:426.32g/molDiflunisal Acyl-β-D-glucuronide
CAS:Controlled ProductFormula:C19H16F2O9Color and Shape:NeatMolecular weight:426.32Diflunisal-acyl-beta-D-glucuronide
CAS:Diflunisal-acyl-beta-D-glucuronide is a metabolite of the non-steroidal anti-inflammatory drug (NSAID) diflunisal, which is derived from the acyl glucuronidation of diflunisal by hepatic enzymes. This process typically involves the enzyme UDP-glucuronosyltransferase, facilitating the compound's increased solubility and excretion.Formula:C19H16F2O9Purity:Min. 95%Molecular weight:426.3 g/mol




