CAS 58457-98-0
:(S)-Methyl 2-N-Cbz-3-N-Boc-propanoate
Description:
(S)-Methyl 2-N-Cbz-3-N-Boc-propanoate is a chiral compound commonly used in organic synthesis, particularly in the preparation of amino acids and peptides. It features a propanoate backbone with two protective groups: a benzyloxycarbonyl (Cbz) and a tert-butyloxycarbonyl (Boc) group, which are employed to protect amine functionalities during chemical reactions. The presence of these protective groups enhances the compound's stability and solubility, making it suitable for various synthetic applications. The (S) configuration indicates that the compound has a specific stereochemistry, which is crucial for its biological activity and interaction with other chiral molecules. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol. Its reactivity can be influenced by the presence of the protective groups, allowing for selective reactions under mild conditions. Overall, (S)-Methyl 2-N-Cbz-3-N-Boc-propanoate is a valuable intermediate in the synthesis of more complex organic molecules, particularly in the pharmaceutical and biochemistry fields.
Formula:C17H24N2O6
InChI:InChI=1/C17H24N2O6/c1-17(2,3)25-15(21)18-10-13(14(20)23-4)19-16(22)24-11-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3,(H,18,21)(H,19,22)/t13-/m0/s1
SMILES:CC(C)(C)OC(=NC[C@@H](C(=O)OC)N=C(O)OCc1ccccc1)O
Synonyms:- 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-N-[(phenylmethoxy)carbonyl]-L-alanine methyl ester
- methyl N-[(benzyloxy)carbonyl]-3-[(tert-butoxycarbonyl)amino]-L-alaninate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-Methyl 2-N-cbz-3-N-boc-propanoate
CAS:Formula:C17H24N2O6Purity:97%Color and Shape:SolidMolecular weight:352.3823(S)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-((tert-butoxycarbonyl)amino)propanoate
CAS:(S)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-((tert-butoxycarbonyl)amino)propanoatePurity:98%Molecular weight:352.39g/molMethyl 2-(S)-[N-Carbobenzyloxy]amino-3-[N-tert-butyloxycarbonyl]aminopropionate
CAS:Controlled ProductApplications Important building block for the synthesis of peptides containing DAP residues, e.g. bleomycins, edeines, tuberactinomycins.
References Mendre, C., et al.: Tetrahedron Lett., 35, 5429 (1994), Shinagaga, S., et al.: J. Med. Chem., 30, 1458 (1987),Formula:C17H24N2O6Color and Shape:NeatMolecular weight:352.38


