CAS 58461-27-1
:(±)-Lavandulol
Description:
(±)-Lavandulol is a naturally occurring monoterpenoid alcohol primarily found in various essential oils, particularly those derived from lavender. It is characterized by its pleasant floral aroma, which contributes to its use in perfumery and aromatherapy. The compound has a chiral center, resulting in two enantiomers, but the "(±)" designation indicates that it is a racemic mixture of both enantiomers. (±)-Lavandulol is known for its potential therapeutic properties, including anti-inflammatory and antimicrobial effects, making it of interest in both the cosmetic and pharmaceutical industries. Its molecular structure features a cyclohexene ring with a hydroxyl group, which influences its solubility and reactivity. The substance is typically colorless to pale yellow and has a relatively low boiling point, which allows it to be easily vaporized for use in various applications. Safety data indicates that it should be handled with care, as with many organic compounds, to avoid potential skin irritation or allergic reactions.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-8(2)5-6-10(7-11)9(3)4/h5,10-11H,3,6-7H2,1-2,4H3
InChI key:InChIKey=CZVXBFUKBZRMKR-UHFFFAOYSA-N
SMILES:C(CC=C(C)C)(C(C)=C)CO
Synonyms:- (+/-)-Lavandulol
- 2-Isopropenyl-5-methyl-4-hexen-1-ol
- 4-Hexen-1-ol, 2-isopropenyl-5-methyl-
- 4-Hexen-1-ol, 5-methyl-2-(1-methylethenyl)-
- 5-Methyl-2-(Prop-1-En-2-Yl)Hex-4-En-1-Ol
- 5-methyl-2-(1-methylethenyl)-4-Hexen-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(+/-)-Lavandulol
CAS:(+/-)-Lavandulol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C10H18OPurity:(GC) ≥95%Color and Shape:LiquidMolecular weight:154.254-Hexen-1-ol, 5-methyl-2-(1-methylethenyl)-
CAS:Formula:C10H18OPurity:95%Color and Shape:LiquidMolecular weight:154.24935-Methyl-2-(prop-1-en-2-yl)hex-4-en-1-ol
CAS:5-Methyl-2-(prop-1-en-2-yl)hex-4-en-1-olPurity:95%Molecular weight:154.25g/molLavandulol
CAS:Acyclic terpene alcoholFormula:C10H18OPurity:≥ 90.0 % (GC)Color and Shape:Oily liquidMolecular weight:154.25rac-lavandulol
CAS:Rac-lavandulol is a monoterpenoid alcohol, which is a racemic mixture of two enantiomers derived synthetically or biosynthetically. It originates from natural plant sources, particularly from the essential oils of certain aromatic herbs like lavender (Lavandula spp.). Possessing a unique odorous quality, rac-lavandulol interacts with olfactory receptors, influencing sensory perception and offering potential therapeutic benefits.
Formula:C10H18OPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:154.25 g/mol








