CAS 58461-30-6
:4-amino-1-(2-chloro-2-deoxy-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one
Description:
4-amino-1-(2-chloro-2-deoxy-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one, with the CAS number 58461-30-6, is a synthetic nucleoside analog that exhibits structural similarities to naturally occurring nucleosides. This compound features a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms, and is substituted with an amino group and a chlorinated sugar moiety. The presence of the 2-chloro-2-deoxy-beta-D-arabinofuranosyl group enhances its potential for biological activity, particularly in antiviral and anticancer applications. The compound's unique structure allows it to interfere with nucleic acid synthesis, making it a candidate for therapeutic use. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, the compound's pharmacological properties, including its mechanism of action and bioavailability, are subjects of ongoing research, particularly in the context of its efficacy against specific viral infections or tumors. Overall, this compound represents a significant area of interest in medicinal chemistry and drug development.
Formula:C9H12ClN3O4
InChI:InChI=1/C9H12ClN3O4/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6+,7-,8-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(2'-Chloro-2'-deoxy-b-D-arabinofuranosyl)cytosine
CAS:1-(2'-Chloro-2'-deoxy-b-D-arabinofuranosyl)cytosine is a synthetic, modified nucleoside that can be phosphorylated to its monophosphate form. It is an inhibitor of DNA synthesis and the replication of viral DNA. 1-(2'-Chloro-2'-deoxy-b-D-arabinofuranosyl)cytosine has been shown to have anticancer activity in vitro and in vivo. This drug is also active against some RNA viruses such as hepatitis B virus and human immunodeficiency virus type 1 (HIV).Formula:C9H12ClN3O4Purity:Min. 95%Molecular weight:261.66 g/mol
