CAS 5847-59-6
:2-Bromo-4-nitrophenol
Description:
2-Bromo-4-nitrophenol is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a phenolic ring. Its molecular formula is C6H4BrN O3, indicating the presence of six carbon atoms, four hydrogen atoms, one bromine atom, one nitrogen atom, and three oxygen atoms. This compound typically appears as a yellow to orange crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. The bromine atom introduces a halogen, which can influence the compound's reactivity, while the nitro group is a strong electron-withdrawing group, affecting the acidity of the hydroxyl group. 2-Bromo-4-nitrophenol is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. It exhibits properties such as being a weak acid due to the phenolic hydroxyl group, and it can participate in electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C6H4BrNO3
InChI:InChI=1S/C6H4BrNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H
InChI key:InChIKey=DCIPFSYBGTWYCR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(Br)=C(O)C=C1
Synonyms:- Nsc 212120
- Phenol, 2-bromo-4-nitro-
- Phenol, 2-bromo-4-nitro- (8CI)(9CI)
- 2-Bromo-4-nitrophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromo-4-nitrophenol
CAS:2-Bromo-4-nitrophenolPurity:98%Color and Shape:White SolidMolecular weight:218.00g/mol2-Bromo-4-nitrophenol
CAS:Formula:C6H4BrNO3Purity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:218.012-Bromo-4-nitrophenol
CAS:Controlled ProductApplications 2-Bromo-4-nitrophenol
Formula:C6H4BrNO3Color and Shape:NeatMolecular weight:218.012-Bromo-4-nitrophenol
CAS:2-Bromo-4-nitrophenol is a byproduct of the reaction between hydrogen peroxide and sodium bromate. It can be detected in the presence of hydrochloric acid, which reacts with 2-bromo-4-nitrophenol to form an orange color that can be detected spectrophotometrically. 2-Bromo-4-nitrophenol has been shown to inhibit the growth of various strains of bacteria, including Escherichia coli, Bacillus subtilis, and Pseudomonas aeruginosa. This compound binds to flavin adenine dinucleotide (FAD) as well as other nucleophilic cofactors such as thioredoxin reductase. The binding affinity is increased when carbon sources are present. This property makes it a useful inhibitor for catalytic reduction reactions in biotechnology and synthetic chemistry applications.br>br> 2B4NP is a byFormula:C6H4BrNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:218 g/mol






