CAS 58470-85-2

4(3H)-Pyrimidinone, 2,6-diamino-, sulfate (1:?)

Description:

4(3H)-Pyrimidinone, 2,6-diamino-, sulfate (1:?) is a chemical compound characterized by its pyrimidine ring structure, which features two amino groups at the 2 and 6 positions, contributing to its basicity and potential for hydrogen bonding. The sulfate component indicates that the compound is likely a salt, which can influence its solubility and stability in various solvents. This compound is often studied for its biological activity, particularly in relation to its role in nucleic acid metabolism and potential therapeutic applications. It may exhibit properties such as being a precursor in the synthesis of nucleotides or other biologically relevant molecules. The presence of amino groups suggests it may participate in various biochemical reactions, including those involving enzyme interactions. Additionally, the sulfate moiety can enhance its solubility in aqueous environments, making it more bioavailable. Overall, this compound's unique structure and functional groups make it of interest in both medicinal chemistry and biochemistry.

Formula: C₄H₆N₄O·xH₂O₄S

InChI: InChI=1S/C4H6N4O.H2O4S/c5-2-1-3(9)8-4(6)7-2;1-5(2,3)4/h1H,(H5,5,6,7,8,9);(H2,1,2,3,4)

InChI key: InChIKey=SLSWVEQLCOSOTJ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)O.NC1=CC(=O)N=C(N)N1

Synonyms:

• 4(1H)-Pyrimidinone, 2,6-diamino-, sulfate
• 4(3H)-Pyrimidinone, 2,6-diamino-, sulfate (1:?)
• 4-Pyrimidinol, 2,6-diamino-, sulfate

2,4-Diamino-6-hydroxypyridine sulphate

CAS: 58470-85-2

2,4-Diamino-6-hydroxypyridine sulphate is a nucleoside for use in research applications

Formula: C₄H₆N₄O•(H₂SO₄)x

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 224.2 g/mol

Ref: 3D-ND69917