CAS 58471-53-7
:asp-asp
Description:
The chemical substance known as "asp-asp," with the CAS number 58471-53-7, is a dipeptide composed of two aspartic acid residues. Aspartic acid is an amino acid that plays a crucial role in various biological processes, including protein synthesis and neurotransmission. The characteristics of this dipeptide include its solubility in water, which is typical for many peptides due to their polar nature. Asp-asp may exhibit specific biological activities, such as acting as a neurotransmitter or influencing metabolic pathways, although its precise functions can vary depending on the context in which it is studied. The structure of asp-asp features a peptide bond linking the two aspartic acid units, which contributes to its stability and reactivity. Additionally, the presence of carboxyl groups in aspartic acid can impart acidic properties to the dipeptide. Overall, asp-asp serves as an important model compound for studying peptide interactions and functions in biochemical research.
Formula:C8H12N2O7
InChI:InChI=1/C8H12N2O7/c9-3(1-5(11)12)7(15)10-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H,10,15)(H,11,12)(H,13,14)(H,16,17)
SMILES:C(C(C(=NC(CC(=O)O)C(=O)O)O)N)C(=O)O
Synonyms:- H-Asp-Asp-OH
- Alpha-Aspartylaspartic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
H-Asp-Asp-OH
CAS:Dipeptides as aspartylaspartate and glutamylglutamate can be utilized as growth substrates for the oral bacteria Porphyromonas gingivalis, Prevotella intermedia, Prevotella nigrescens and Fusobacterium nucleatum.Formula:C8H12N2O7Purity:> 99%Color and Shape:White PowderMolecular weight:248.19L-Aspartic acid, L-a-aspartyl-
CAS:Formula:C8H12N2O7Purity:95%Color and Shape:SolidMolecular weight:248.1901(S)-2-((S)-2-Amino-3-carboxypropanamido)succinic acid
CAS:(S)-2-((S)-2-Amino-3-carboxypropanamido)succinic acidPurity:95%Molecular weight:248.19g/molH-Asp-Asp-OH
CAS:H-Asp-Asp-OH is a basic protein that is found in all organisms. It has been shown to have a role in the regulation of the immune system and in the development of cancer. H-Asp-Asp-OH has been studied for its use as an antigen for the production of monoclonal antibodies and as a potential therapeutic agent against infectious diseases and autoimmune diseases. The molecule consists of two amino acids, Aspartic acid and Asparagine, linked by an amide bond. The molecular weight is 212 daltons, which is too small to be filtered by size exclusion chromatography.Formula:C8H12N2O7Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:248.19 g/mol(S)-2-((S)-2-Amino-3-carboxypropanamido)succinic acid
CAS:Formula:C8H12N2O7Purity:95%Molecular weight:248.191
