CAS 58479-77-9
:5-(carboxymethyl)-1-beta-D-ribofuranosyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one
Description:
5-(Carboxymethyl)-1-beta-D-ribofuranosyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 58479-77-9, is a chemical compound that belongs to the class of thioxo-pyrimidinones. This substance features a ribofuranosyl moiety, which indicates that it has a sugar component, specifically a ribose sugar, contributing to its potential biological activity. The presence of a carboxymethyl group suggests that it may exhibit acidic properties, while the thioxo group indicates the presence of sulfur, which can influence the compound's reactivity and stability. This compound is of interest in medicinal chemistry and biochemistry due to its structural similarity to nucleosides, which are essential components of nucleic acids. Its unique structure may confer specific interactions with biological targets, making it a candidate for further research in drug development or as a biochemical probe. Overall, its characteristics suggest potential applications in pharmacology and biochemistry, although specific biological activities would require empirical investigation.
Formula:C11H14N2O7S
InChI:InChI=1/C11H14N2O7S/c14-3-5-7(17)8(18)10(20-5)13-2-4(1-6(15)16)9(19)12-11(13)21/h2,5,7-8,10,14,17-18H,1,3H2,(H,15,16)(H,12,19,21)/t5-,7-,8-,10-/m1/s1
SMILES:C(c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=S)nc1O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Carboxymethyl-2-thiouridine
CAS:<p>Nucleoside Derivatives - 5-Modified pyrimidine nucleosides; 2-Thio-nucleosides</p>Formula:C11H14N2O7SColor and Shape:SolidMolecular weight:318.35-Carboxymethyl-2-thiouridine
CAS:<p>5-Carboxymethyl-2-thiouridine is a modified form of uridine that has been synthesized by the reaction of 5-carboxymethyluracil with thiourea. It is used in chemical biology to study protein synthesis and to analyze the structural changes that occur during this process. 5-Carboxymethyl-2-thiouridine has also been shown to be effective as a viral RNA polymerase inhibitor, preventing the synthesis of viral proteins and thus reducing viral replication. This drug is also used in chromatographic methods for separating amino acids, peptides, and proteins.</p>Formula:C11H14N2O7SPurity:Min. 95%Molecular weight:318.3 g/mol

