CAS 5848-25-9

Methyl N-cyano-N′-ethylcarbamimidothioate

Description:

Methyl N-cyano-N′-ethylcarbamimidothioate, with the CAS number 5848-25-9, is a chemical compound that belongs to the class of thioates and is characterized by its unique functional groups. It features a methyl group, a cyano group, and a carbamimidothioate structure, which contributes to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. The presence of the cyano group indicates that it may exhibit certain biological activities, potentially acting as a pesticide or herbicide. Additionally, the thioate moiety can influence its interaction with biological systems, possibly affecting its toxicity and efficacy. This compound is typically synthesized through specific chemical reactions involving thiourea derivatives and other reagents. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Its physical properties, such as solubility and stability, can vary based on environmental conditions and the presence of other substances.

Formula: C₅H₉N₃S

InChI: InChI=1S/C5H9N3S/c1-3-7-5(9-2)8-4-6/h3H2,1-2H3,(H,7,8)

InChI key: InChIKey=BUFQRIDSXBTSDH-UHFFFAOYSA-N

SMILES: C(=NCC)(NC#N)SC

N'-Cyano-N-ethyl(methylsulfanyl)methanimidamide

CAS: 5848-25-9

Versatile small molecule scaffold

Formula: C₅H₉N₃S

Purity: Min. 95%

Molecular weight: 143.21 g/mol

Ref: 3D-FAA84825