CAS 58480-54-9
:Lehmannine
Description:
Lehmannine, with the CAS number 58480-54-9, is a naturally occurring alkaloid primarily derived from certain plant species. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Lehmannine exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. The substance is typically found in specific plant extracts and may be studied for its interactions with various biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. As with many alkaloids, lehmannine's effects can be dose-dependent, and its safety profile is an important consideration in any pharmacological studies. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in medicine.
Formula:C15H22N2O
InChI:InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,6,11-13,15H,2-5,7-10H2/t11-,12+,13+,15-/m0/s1
InChI key:InChIKey=WUVYENIUARJBNM-JLNYLFASSA-N
SMILES:O=C1N2[C@@]([C@@]3([C@@]4([C@](C2)(CCCN4CCC3)[H])[H])[H])(C=CC1)[H]
Synonyms:- (+)-Lehmannine
- (+)-Lemannine
- (7aS,13aR,13bS,13cS)-2,3,6,7,7a,8,11,13a,13b,13c-Decahydro-1H,5H,10H-dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one
- 12-Dehydromatrine
- 1H,5H,10H-Dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one, 2,3,6,7,7a,8,11,13a,13b,13c-decahydro-, (7aS,13aR,13bS,13cS)-
- 1H,5H,10H-Dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one, 2,3,6,7,7a,8,11,13a,13b,13c-decahydro-, [7aS-(7aα,13aβ,13bα,13cα)]-
- 1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one, 2,3,6,7,7a,8,11,13a,13b,13c-decahydro-, (7aS,13aR,13bS,13cS)-
- Matridin-15-one, 12,13-didehydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lehmannine
CAS:Lehmannine is a natural product of Ammothamnus, Fabaceae.Formula:C15H22N2OColor and Shape:SolidMolecular weight:246.35Lehmannine
CAS:Lehmannine is a basic fibroblast growth factor (bFGF) found in Chinese medicine preparations that has been used to treat rabies, snakebites, and other venomous bites. It was first isolated from the Chinese herb robinia. Lehmannine has been shown to have anthelmintic properties, which may be due to its ability to cause paralysis of the worms' suckers. Lehmannine binds to the receptor sites on the surface of the worm's cells and causes paralysis by preventing muscle contraction. The binding of lehmannine is reversible and it can be detected with high sensitivity at phase transition temperature. Lehmannine also inhibits glutinosa activity.
Formula:C15H22N2OPurity:Min. 95%Molecular weight:246.35 g/mol


