CAS 58497-00-0
:Procinonide
Description:
Procinonide, with the CAS number 58497-00-0, is a synthetic corticosteroid primarily used for its anti-inflammatory and immunosuppressive properties. It is characterized by its ability to modulate the immune response and reduce inflammation, making it effective in treating various dermatological conditions, such as eczema and psoriasis. Procinonide functions by binding to glucocorticoid receptors, leading to the transcription of anti-inflammatory proteins and the suppression of pro-inflammatory cytokines. This compound typically exhibits a favorable pharmacokinetic profile, allowing for topical application with minimal systemic absorption. Its formulation may include various excipients to enhance skin penetration and stability. As with other corticosteroids, prolonged use can lead to potential side effects, including skin atrophy and systemic effects if absorbed in significant amounts. Therefore, it is essential to use Procinonide under medical supervision, adhering to prescribed dosages and treatment durations to mitigate risks while maximizing therapeutic benefits.
Formula:C27H34F2O7
InChI:InChI=1S/C27H34F2O7/c1-6-22(33)34-13-20(32)27-21(35-23(2,3)36-27)11-15-16-10-18(28)17-9-14(30)7-8-24(17,4)26(16,29)19(31)12-25(15,27)5/h7-9,15-16,18-19,21,31H,6,10-13H2,1-5H3/t15-,16-,18-,19-,21+,24-,25-,26-,27+/m0/s1
InChI key:InChIKey=UBOIMZIXNXGQOH-RTWVSBIPSA-N
SMILES:C(COC(CC)=O)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(OC(C)(C)O2)[H])([C@]4([C@](F)([C@@H](O)C3)[C@]5(C)C([C@@H](F)C4)=CC(=O)C=C5)[H])[H]
Synonyms:- (6α,11β,16α)-6,9-Difluoro-11-hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-21-(1-oxopropoxy)pregna-1,4-diene-3,20-dione
- 2-(4b,12-difluoro-5-hydroxy-4a,6a,8,8-tetramethyl-2-oxo-2,4a,4b,5,6,6a,9a,10,10a,10b,11,12-dodecahydro-6bH-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-6b-yl)-2-oxoethyl propanoate
- 2-[(4bR,6bS,9aR,12S)-4b,12-difluoro-5-hydroxy-4a,6a,8,8-tetramethyl-2-oxo-2,4a,4b,5,6,6a,9a,10,10a,10b,11,12-dodecahydro-6bH-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-6b-yl]-2-oxoethyl propanoate
- Fluocinolone acetonide 21-propionate
- Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11-hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-21-(1-oxopropoxy)-, (6α,11β,16α)-
- Rs 2352
- Procinonide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
