CAS 585-23-9
:3-[(Aminocarbonyl)amino]alanine
Description:
3-[(Aminocarbonyl)amino]alanine, also known as L-Serine, is an amino acid characterized by its dual functional groups: an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical of amino acids. This compound features a side chain that includes an aminocarbonyl group, contributing to its classification as a non-essential amino acid. It plays a crucial role in various biological processes, including protein synthesis and neurotransmitter production. The presence of the aminocarbonyl group enhances its reactivity and solubility in water, making it biologically relevant. Additionally, it is involved in metabolic pathways, particularly in the synthesis of other amino acids and biomolecules. The compound is typically found in a crystalline form and is stable under standard conditions, although it may be sensitive to extreme pH levels and temperatures. Its CAS number, 585-23-9, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 3-[(Aminocarbonyl)amino]alanine is significant in both biochemical research and potential therapeutic applications.
Formula:C4H9N3O3
InChI:InChI=1S/C4H9N3O3/c5-2(3(8)9)1-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)
InChI key:InChIKey=GZYFIMLSHBLMKF-UHFFFAOYSA-N
SMILES:C(CNC(N)=O)(C(O)=O)N
Synonyms:- Alanine, 3-[(aminocarbonyl)amino]-
- 3-[(Aminocarbonyl)amino]alanine
- Propionic acid, 2-amino-3-ureido-
- 2-Amino-3-(carbamoylamino)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
