CAS 585-70-6
:5-Bromo-2-furancarboxylic acid
Description:
5-Bromo-2-furancarboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a bromine substituent at the 5-position and a carboxylic acid group at the 2-position of the furan ring. It is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Additionally, 5-Bromo-2-furancarboxylic acid can serve as a building block for more complex molecules in organic synthesis. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C5H3BrO3
InChI:InChI=1S/C5H3BrO3/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8)
InChI key:InChIKey=YVTQHZDUDUCGRD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(Br)=CC1
Synonyms:- 2-Furancarboxylic acid, 5-bromo-
- 2-Furoic acid, 5-bromo-
- 5-Bromo-2-Furanecarboxylic Acid
- 5-Bromo-2-furancarboxylic acid
- 5-Bromo-2-furanoic acid
- 5-Bromo-2-furoic acid
- 5-Bromo-furan-2-carboxylic acid
- 5-Bromofuran-2-Carboxylate
- 5-Bromofuroicacid
- NSC 32221
- 5-Bromofuroic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-furoic acid, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H3BrO3Purity:99%Color and Shape:White to cream to pale brown, Crystals or powder or crystalline powderMolecular weight:190.985-Bromofuran-2-carboxylic acid
CAS:Formula:C5H3BrO3Purity:98%Color and Shape:SolidMolecular weight:190.97955-Bromo-2-furoic acid
CAS:Formula:C5H3BrO3Purity:≥ 98.0%Color and Shape:Off-white to brown solidMolecular weight:190.995-Bromo-furan-2-carboxylic acid
CAS:Formula:C5H3BrO3Purity:97%Color and Shape:Solid, PowderMolecular weight:190.98




