CAS 585-81-9

3-hydroxy-5-methylbenzoic acid

Description:

3-Hydroxy-5-methylbenzoic acid, also known as 3-hydroxy-5-methylsalicylic acid, is an aromatic carboxylic acid characterized by the presence of both a hydroxyl group (-OH) and a carboxylic acid group (-COOH) on a benzene ring. The molecular structure features a methyl group (-CH3) at the 5-position and a hydroxyl group at the 3-position relative to the carboxylic acid. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, due to the presence of its functional groups. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, 3-hydroxy-5-methylbenzoic acid may have applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its unique structure contributes to its potential biological activity, making it a subject of interest in medicinal chemistry and research.

Formula: C₈H₈O₃

InChI: InChI=1/C8H8O3/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4,9H,1H3,(H,10,11)

SMILES: Cc1cc(cc(c1)O)C(=O)O

Synonyms:

• Benzoic Acid, 3-Hydroxy-5-Methyl-

3-Hydroxy-5-methylbenzoic acid

CAS: 585-81-9

Formula: C₈H₈O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.1473

Ref: IN-DA0038MO

3-Hydroxy-5-methylbenzoic acid

CAS: 585-81-9

3-Hydroxy-5-methylbenzoic acid

Purity: 97%

Molecular weight: 152.15g/mol

Ref: 54-OR345377

3-Hydroxy-5-methylbenzoic acid

CAS: 585-81-9

3-Hydroxy-5-methylbenzoic acid is a gentisate oxidation product that is obtained from the degradation of 3-hydroxybenzoic acid. Gentisate is synthesized by Pseudomonas fluorescens, which belongs to the genus Pseudomonas. This product has been shown to inhibit the growth of Pseudomonas aeruginosa and other fluorescent pseudomonads, but not other bacteria such as Escherichia coli and Staphylococcus aureus. The mechanism of this inhibition may be due to the production of reactive oxygen species (ROS) by these organisms. 3-Hydroxy-5-methylbenzoic acid can also act as an antioxidant in alkaline conditions by reducing 2,5-dihydroxybenzoic acid to benzoic acid. It has also been shown to be a fluorescent product that can be used for unambiguous identification of Pseudomonas fluorescens isolates and

Formula: C₈H₈O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 152.15 g/mol

Ref: 3D-FH12521

3-Hydroxy-5-methylbenzoic acid

CAS: 585-81-9

Formula: C₈H₈O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.149

Ref: 10-F047736