CAS 58506-24-4
:(2-methoxy-5-methylphenyl)acetate
Description:
(2-Methoxy-5-methylphenyl)acetate, with the CAS number 58506-24-4, is an organic compound characterized by its aromatic structure and ester functional group. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a phenyl ring, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a pleasant, sweet odor, making it potentially useful in flavor and fragrance applications. Its molecular structure suggests moderate polarity, which influences its solubility in organic solvents while being less soluble in water. The presence of the acetate group indicates that it can undergo hydrolysis in the presence of water, leading to the formation of acetic acid and the corresponding phenol. Additionally, (2-methoxy-5-methylphenyl)acetate may exhibit biological activity, which could be of interest in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C10H11O3
InChI:InChI=1/C10H12O3/c1-7-3-4-9(13-2)8(5-7)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1
SMILES:Cc1ccc(c(c1)CC(=O)[O-])OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2-Methoxy-5-methylphenyl)acetic acid
CAS:Formula:C10H12O3Purity:95%Color and Shape:SolidMolecular weight:180.20052-Methoxy-5-methylphenylacetic acid
CAS:Formula:C10H12O3Purity:>95%Color and Shape:Solid, Yellow powderMolecular weight:180.2032-Methoxy-5-methylphenylacetic acid
CAS:<p>2-Methoxy-5-methylphenylacetic acid is a chiral molecule that has been studied in the area of pyridine chemistry. It is an analogue of 2-methoxybenzaldehyde and has been used as a starting material for the synthesis of flavonoids, including trans-stilbene. The stereochemistry of this molecule is not known but it has been shown to be isomerized by treatment with boron trifluoride.</p>Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol
