CAS 58511-20-9

[(4-methylbenzyl)sulfanyl]acetic acid

Description:

[(4-Methylbenzyl)sulfanyl]acetic acid, with the CAS number 58511-20-9, is an organic compound characterized by the presence of a sulfanyl (thioether) functional group attached to an acetic acid moiety. This compound features a 4-methylbenzyl group, which contributes to its hydrophobic characteristics, while the acetic acid portion provides acidic properties due to the carboxylic acid functional group. The presence of the sulfur atom in the sulfanyl group can impart unique reactivity and potential for forming disulfide bonds, which may be relevant in various chemical reactions and biological systems. The compound is likely to be soluble in organic solvents and may exhibit moderate solubility in water due to the polar carboxylic acid group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₂O₂S

InChI: InChI=1/C10H12O2S/c1-8-2-4-9(5-3-8)6-13-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)

SMILES: Cc1ccc(cc1)CSCC(=O)O

Synonyms:

• Acetic Acid, 2-[[(4-Methylphenyl)Methyl]Thio]-

2-{[(4-Methylphenyl)methyl]sulfanyl}acetic acid

CAS: 58511-20-9

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₂S

Purity: Min. 95%

Molecular weight: 196.27 g/mol

Ref: 3D-ICA51120