
CAS 5852-10-8
:7-hydroxy-4-methyl-3-coumarinylacetic acid
Description:
7-Hydroxy-4-methyl-3-coumarinylacetic acid, with the CAS number 5852-10-8, is a chemical compound belonging to the coumarin family, which is known for its aromatic properties and potential biological activities. This compound features a coumarin backbone, characterized by a benzopyrone structure, with a hydroxyl group at the 7-position and a methyl group at the 4-position, contributing to its unique chemical properties. The acetic acid moiety enhances its solubility in polar solvents and may influence its reactivity and biological interactions. 7-Hydroxy-4-methyl-3-coumarinylacetic acid has been studied for its potential applications in pharmaceuticals, particularly due to its antioxidant and anti-inflammatory properties. Additionally, it may exhibit fluorescence, making it useful in various analytical and imaging techniques. The compound's stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature, which are important considerations in its practical applications. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry.
Formula:C12H10O5
InChI:InChI=1/C12H10O5/c1-6-8-3-2-7(13)4-10(8)17-12(16)9(6)5-11(14)15/h2-4,13H,5H2,1H3,(H,14,15)
SMILES:Cc1c2ccc(cc2oc(=O)c1CC(=O)O)O
Synonyms:- 7-Hydroxy-4-methylcoumarin-3-acetic acid
- (6-nitro-1H-benzimidazol-2-yl)acetonitrile
- (7-hydroxy-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
- 7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran-3-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Hydroxy-4-methylcoumarin-3-acetic Acid
CAS:Formula:C12H10O5Purity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:234.217-Hydroxy-4-methylcoumarin-3-acetic acid
CAS:Formula:C12H10O5Purity:95%Color and Shape:SolidMolecular weight:234.20487-Hydroxy-4-methylcoumarin-3-acetic acid
CAS:7-Hydroxy-4-methylcoumarin-3-acetic acidPurity:98%Molecular weight:234.20g/mol7-Hydroxy-4-methylcoumarin-3-acetic acid
CAS:7-Hydroxy-4-methylcoumarin-3-acetic acid is a blue fluorophore with pH-dependent and environmentally sensitive,to peptides, nucleotides, and carbohydrates.Formula:C12H10O5Purity:99.39%Color and Shape:SolidMolecular weight:234.27-Hydroxy-4-methyl-3-coumarinylacetic acid
CAS:<p>7-Hydroxy-4-methyl-3-coumarinylacetic acid (7HMCA) is an analog of 7-amino-4-methylcoumarin. It is a fluorescent material that can be used as a dye in analytical chemistry. The fluorescence of 7HMCA depends on the pH and temperature, as well as the presence of reactive oxygen species such as gadolinium or carbostyril. 7HMCA binds to the molecule's amino group, which has been shown to contribute to its stability and reactivity.</p>Formula:C12H10O5Purity:Min. 95%Color and Shape:PowderMolecular weight:234.20 g/mol2-(7-Hydroxy-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
CAS:Formula:C12H10O5Purity:98%Molecular weight:234.207





