CymitQuimica logo

CAS 58524-63-3

:

1,3-Diamino-4-(heptafluoroisopropyl)benzene dihydrochloride

Description:
1,3-Diamino-4-(heptafluoroisopropyl)benzene dihydrochloride, with the CAS number 58524-63-3, is a chemical compound characterized by its aromatic structure, which includes a benzene ring substituted with two amino groups and a heptafluoroisopropyl group. The presence of the amino groups (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and materials science. The heptafluoroisopropyl substituent contributes to the compound's unique properties, such as increased hydrophobicity and thermal stability, which can enhance its performance in specific applications. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in aqueous environments. Safety data should be consulted, as compounds containing fluorinated groups can exhibit unique toxicological profiles. Overall, this compound's distinctive structure and properties make it of interest in various fields, including pharmaceuticals and advanced materials.
Formula:C9H7F7N2
InChI:InChI=1/C9H7F7N2/c10-7(8(11,12)13,9(14,15)16)5-2-1-4(17)3-6(5)18/h1-3H,17-18H2
SMILES:c1cc(c(cc1N)N)C(C(F)(F)F)(C(F)(F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.