CAS 5853-16-7
:Carbonic acid, cerium(3+) salt (3:2), pentadecahydrate
Description:
Carbonic acid, cerium(3+) salt (3:2), pentadecahydrate, with the CAS number 5853-16-7, is a hydrated inorganic compound that consists of cerium ions combined with carbonate ions in a specific stoichiometric ratio. This compound typically appears as a crystalline solid and is characterized by its high water content, as indicated by the pentadecahydrate designation, which means it contains fifteen water molecules per formula unit. Cerium(3+) ions are known for their role in various catalytic processes and their applications in materials science, particularly in the production of ceramics and glass. The presence of carbonate ions suggests that the compound may exhibit buffering properties, making it relevant in biochemical and environmental contexts. Additionally, the stability and solubility of this compound can be influenced by factors such as pH and temperature, which are important for its practical applications. Overall, this compound is of interest in both industrial and research settings due to its unique properties and potential uses.
Formula:CH2O3Ce·5H2O
InChI:InChI=1S/CH2O3.Ce.5H2O/c2-1(3)4;;;;;;/h(H2,2,3,4);;5*1H2
InChI key:InChIKey=QXFUBESUKREZNB-UHFFFAOYSA-N
SMILES:C(=O)(O)O.[Ce].O
Synonyms:- Carbonic acid, cerium(3+) salt (3:2), pentadecahydrate
- Cerium(3+) Carbonate Hydrate (2:3:15)
- Ceriumcarbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
