
CAS 5853-83-8
:N6-L-β-Aspartyl-L-lysine
Description:
N6-L-β-Aspartyl-L-lysine, also known by its CAS number 5853-83-8, is a dipeptide composed of the amino acids aspartic acid and lysine. This compound features a unique structure where the aspartic acid is linked to the lysine through a peptide bond, specifically at the N6 position of lysine. It is characterized by its polar nature due to the presence of carboxyl and amino groups, which contribute to its solubility in water. The compound is often studied for its potential biological activities, including roles in neurotransmission and cellular signaling. Additionally, it may exhibit properties that are beneficial in various biochemical applications, such as in the development of pharmaceuticals or as a research tool in peptide chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, N6-L-β-Aspartyl-L-lysine represents a significant compound in the field of biochemistry and molecular biology.
Formula:C10H19N3O5
InChI:InChI=1S/C10H19N3O5/c11-6(9(15)16)3-1-2-4-13-8(14)5-7(12)10(17)18/h6-7H,1-5,11-12H2,(H,13,14)(H,15,16)(H,17,18)/t6-,7-/m0/s1
InChI key:InChIKey=VNJVIQOAVBMTIB-BQBZGAKWSA-N
SMILES:C(C[C@@H](C(O)=O)N)(NCCCC[C@@H](C(O)=O)N)=O
Synonyms:- Lysine, N6-L-β-aspartyl-
- L-Lysine, N6-L-β-aspartyl-
- Lysine, N6-L-β-aspartyl-, L-
- Nε-(β-Aspartyl)-L-lysine
- N6-L-β-Aspartyl-L-lysine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aspartyllysine
CAS:<p>Aspartyllysine, a hydrophilic dipeptide in wheat and fish, is excreted by kidneys via H+/peptide transport.</p>Formula:C10H19N3O5Color and Shape:SolidMolecular weight:261.27
