CAS 58530-13-5

3-Bromo-5-methylbenzoic acid

Description:

3-Bromo-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methyl group on a benzoic acid framework. The bromine substituent is located at the meta position (3-position) relative to the carboxylic acid group, while the methyl group is at the para position (5-position). This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic aromatic structure. It exhibits typical acid properties, including the ability to donate a proton (H+) from its carboxylic acid group, making it a weak acid. The presence of the bromine atom can influence its reactivity, making it useful in various chemical syntheses, including the preparation of pharmaceuticals and agrochemicals. Additionally, the compound can undergo electrophilic substitution reactions due to the electron-withdrawing nature of the carboxylic acid and the electron-donating nature of the methyl group, allowing for further functionalization.

Formula: C₈H₇BrO₂

InChI: InChI=1/C8H7BrO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,1H3,(H,10,11)

SMILES: Cc1cc(cc(c1)Br)C(=O)O

Synonyms:

• Benzoic acid, 3-bromo-5-methyl-
• 3-Bromo-5-Methyl benzoic acid

3-Bromo-5-methylbenzoic acid

CAS: 58530-13-5

Formula: C₈H₇BrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.0440

Ref: IN-DA003J35

3-Bromo-5-methylbenzoic acid

CAS: 58530-13-5

3-Bromo-5-methylbenzoic acid

Formula: C₈H₇BrO₂

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 215.04g/mol

Ref: 54-OR400183

3-Bromo-5-methylbenzoic acid

CAS: 58530-13-5

Formula: C₈H₇BrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.046

Ref: 10-F038171