CAS 58534-64-8
:3,4-Bis(acetyloxy)benzoic acid
Description:
3,4-Bis(acetyloxy)benzoic acid, with the CAS number 58534-64-8, is an organic compound characterized by its structure, which includes a benzoic acid core substituted with two acetoxy groups at the 3 and 4 positions. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as acetone and ethanol, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the acetoxy groups enhances its reactivity, making it useful in various chemical reactions, including esterification and acylation. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical applications. Its melting point and boiling point can vary based on purity and environmental conditions. As with many organic compounds, handling should be done with care, following appropriate safety protocols to avoid exposure. Overall, 3,4-Bis(acetyloxy)benzoic acid is a versatile compound with potential applications in both research and industry.
Formula:C11H9O6
InChI:InChI=1/C11H10O6/c1-6(12)16-9-4-3-8(11(14)15)5-10(9)17-7(2)13/h3-5H,1-2H3,(H,14,15)/p-1
InChI key:InChIKey=FJVSTYFZOUSZCS-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=C(OC(C)=O)C=CC(C(O)=O)=C1
Synonyms:- 3,4-Bis(Acetyloxy)Benzoate
- 3,4-Bis(acetyloxy)benzoic acid
- 3,4-Diacetyloxybenzoic acid
- Benzoic acid, 3,4-bis(acetyloxy)-
- Brn 2698785
- Protocatechuic acid, diacetate
- Protocatechuic acid, diacetate (6CI,7CI)
- 3-10-00-01408 (Beilstein Handbook Reference)
- 3,4-Diacetoxybenzoic acid
- 3,4-Diacetoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Diacetoxybenzoic acid
CAS:3,4-Diacetoxybenzoic acid is a tetronic acid that can be synthesized from protocatechuic acid. It has potent inhibitory activity against lipoxygenase, which is an enzyme responsible for the production of leukotrienes and other lipid compounds in the human body. 3,4-Diacetoxybenzoic acid inhibits fatty acid synthesis by inhibiting the enzyme acyl-CoA synthetase. This compound also has been shown to inhibit the growth of bacteria such as Pseudomonas aeruginosa and Trichophyton mentagrophytes, which are both associated with skin infections. 3,4-Diacetoxybenzoic acid may also have anti-inflammatory properties due to its ability to inhibit prostaglandin synthesis.Formula:C11H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:238.19 g/molProtocatechuic Acid Diacetate
CAS:Controlled ProductApplications Protocatechuic Acid Diacetate is an intermediate in the synthesis of Roflumilast (R639700), an selective phosphodiesterase 4(PDE4) inhibitor.
References Yu, S.H., et al.: J. Enzy. Inhib. Med. Chem., 27, 628 (2012);Formula:C11H10O6Color and Shape:NeatMolecular weight:238.19



