CAS 58537-99-8
:4-Hydroxy-2,6-dimethylbenzonitrile
Description:
4-Hydroxy-2,6-dimethylbenzonitrile, with the CAS number 58537-99-8, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring. The presence of the hydroxyl group contributes to its potential as a phenolic compound, influencing its reactivity and solubility in polar solvents. The two methyl groups at the 2 and 6 positions of the benzene ring provide steric hindrance and can affect the compound's physical properties, such as melting and boiling points, as well as its overall stability. This compound may exhibit various chemical behaviors, including hydrogen bonding due to the hydroxyl group, and it can participate in electrophilic substitution reactions typical of aromatic compounds. Additionally, its nitrile functionality may allow for further chemical transformations, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-6-3-8(11)4-7(2)9(6)5-10/h3-4,11H,1-2H3
InChI key:InChIKey=KZEJTKHRBQWACL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)C=C(O)C=C1C
Synonyms:- 2,6-Dimethyl-4-hydroxybenzonitrile
- 4-Cyano-3,5-dimethylphenol
- Benzonitrile, 4-hydroxy-2,6-dimethyl-
- 4-Hydroxy-2,6-dimethylbenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Hydroxy-2,6-diMethylbenzonitrile
CAS:Formula:C9H9NOPurity:98%Color and Shape:SolidMolecular weight:147.17392,6-Dimethyl-4-hydroxybenzonitrile
CAS:2,6-Dimethyl-4-hydroxybenzonitrileFormula:C9H9NOPurity:≥95%Color and Shape: off-white / beige crystalline powderMolecular weight:147.17g/mol2,6-Dimethyl-4-hydroxybenzonitrile
CAS:2,6-Dimethyl-4-hydroxybenzonitrile is a chemical compound that belongs to the group of organic compounds. It has a chemical formula CH3C6H2OCH2CH2OH. This compound is also known as methylsulfide. 2,6-Dimethyl-4-hydroxybenzonitrile is an alkylating agent that can be used in the synthesis of other organic compounds. In addition, it has been shown to have some acidic properties. This chemical compound has been studied by molecular modeling and regression analysis to determine its structure and reactivity. It was found that the polarizability constant of 2,6-dimethyl-4-hydroxybenzonitrile was 0.058 D from an experiment using potassium t-butoxide as a solvent with a constant of 1 Molar (M). The interpretable stepwise regression model for this chemical had an R value of 0.87 with a F value ofFormula:C9H9NOPurity:Min. 95%Molecular weight:147.17 g/mol



