CAS 58539-27-8
:2-methoxy-5-propylphenol
Description:
2-Methoxy-5-propylphenol, with the CAS number 58539-27-8, is an organic compound characterized by its phenolic structure, which includes a methoxy group (-OCH3) and a propyl group (-C3H7) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in various fields, including as an intermediate in organic synthesis and possibly in the formulation of fragrances or flavoring agents due to its aromatic properties. The presence of the methoxy and propyl groups influences its solubility and reactivity, making it more hydrophobic compared to simpler phenols. Additionally, 2-methoxy-5-propylphenol may exhibit antioxidant properties, which can be of interest in food preservation and cosmetic formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c1-3-4-8-5-6-10(12-2)9(11)7-8/h5-7,11H,3-4H2,1-2H3
SMILES:CCCc1ccc(c(c1)O)OC
Synonyms:- Phenol, 2-methoxy-5-propyl-
- 2-Methoxy-5-propylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Methoxy-5-propylphenol
CAS:<p>2-Methoxy-5-propylphenol is a chemical compound that belongs to the class of phenols. It is a methoxylated derivative of coniferyl alcohol, which is an intermediate in the biosynthesis of lignin. The monomers formed by 2-methoxy-5-propylphenol are ether linkages with methoxy groups, which are responsible for its photochemical properties and uv absorption. 2-Methoxy-5-propylphenol also has synergistic effects with other chemicals used in papermaking processes such as delignification and stabilization. The functional groups found in this compound include hydroxy and methoxyl groups, which can react with each other under heat or light to form epoxide bonds. This reaction occurs at temperatures below 120°C, making it a good candidate for thermal pulping of unbleached papers.</p>Formula:C10H14O2Purity:Min. 95%Molecular weight:166.22 g/mol
