CAS 5854-95-5
:DL-Alanosine
Description:
DL-Alanosine, with the CAS number 5854-95-5, is a synthetic amino acid derivative that is primarily known for its role in biochemical research and potential therapeutic applications. It is characterized by its structural similarity to naturally occurring amino acids, which allows it to participate in various metabolic pathways. DL-Alanosine is typically a white to off-white crystalline powder, soluble in water, and exhibits a neutral pH in solution. Its molecular structure includes both amino and carboxyl functional groups, making it amphoteric and capable of acting as both an acid and a base. This compound has garnered interest due to its potential effects on cellular metabolism and its use in studies related to neurobiology and cancer research. However, as with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, DL-Alanosine serves as a valuable tool in scientific research, contributing to our understanding of amino acid metabolism and its implications in health and disease.
Formula:C3H7N3O4
InChI:InChI=1S/C3H7N3O4/c4-2(3(7)8)1-6(10)5-9/h2,10H,1,4H2,(H,7,8)
InChI key:InChIKey=MLFKVJCWGUZWNV-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)N(N=O)O
Synonyms:- DL-2-Amino-3-(hydroxynitrosamino)propionic acid
- Propionic acid, 2-amino-3-(hydroxynitrosamino)-, DL-
- Alanine, 3-(hydroxynitrosoamino)-
- 3-(Hydroxynitrosoamino)alanine
- DL-Alanine, 3-(hydroxynitrosoamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
D,L-Alanosine Sodium Salt
CAS:Controlled ProductStability Hygroscopic
Applications D,L-Alanosine is an antibiotic substance from the fermentation of Streptomyces alanosinicus. An experimental insect reproduction inhibitor.
References Gale, et al.: Biochem. Pharmacol., 17, 363 (1968); Kenaga, E.E.: J. Econ. Entomol., 62, 1006 (1969); Matsumoto, S., et al.: Agric. Biol. Chem., 48, 827 (1984)Formula:C3H6N3NaO4Color and Shape:NeatMolecular weight:171.09DL-Alanosine
CAS:DL-Alanosine is an amino acid analog with antitumor activity.Formula:C3H7N3O4Color and Shape:SolidMolecular weight:149.105


