CAS 58543-89-8
:4-chloro-2,5-dimethoxybenzonitrile
Description:
4-Chloro-2,5-dimethoxybenzonitrile, with the CAS number 58543-89-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group and two methoxy groups, as well as a nitrile functional group. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents. The presence of the chloro substituent can influence its reactivity and polarity, while the methoxy groups can enhance its electron-donating properties, affecting its behavior in chemical reactions. The nitrile group contributes to the compound's overall polarity and can participate in various chemical transformations. 4-Chloro-2,5-dimethoxybenzonitrile is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its functional groups that allow for further derivatization. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H8ClNO2
InChI:InChI=1/C9H8ClNO2/c1-12-8-4-7(10)9(13-2)3-6(8)5-11/h3-4H,1-2H3
SMILES:COc1cc(c(cc1C#N)OC)Cl
Synonyms:- Benzonitrile, 4-Chloro-2,5-Dimethoxy-
- 4-CHLORO-2,5-DIMETHOXYBENZONITRILE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
