CAS 58546-55-7
:Schisantherin B
Description:
Schisantherin B is a natural compound classified as a lignan, primarily derived from the plant Schisandra chinensis, which is known for its medicinal properties. This compound exhibits a complex molecular structure characterized by multiple aromatic rings and hydroxyl groups, contributing to its biological activity. Schisantherin B has been studied for its potential antioxidant, anti-inflammatory, and hepatoprotective effects, making it of interest in pharmacological research. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is typical for lignans. Additionally, Schisantherin B may interact with various biological pathways, influencing cellular processes and exhibiting potential therapeutic benefits. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in herbal medicine and dietary supplements. Overall, Schisantherin B represents a significant compound in the field of natural products chemistry, with ongoing research aimed at fully elucidating its mechanisms of action and potential health benefits.
Formula:C28H34O9
InChI:InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-18(31-5)22(32-6)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-19-23(24(20)33-7)36-13-35-19/h9,11-12,15,26,30H,10,13H2,1-8H3
InChI key:InChIKey=BKGUPIVDQHHVMV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC4=C(C3OC)OCO4)CC(C)C(C)(O)C(OC(C(=CC)C)=O)C2=CC(OC)=C1OC
Synonyms:- (5R,6S,7S)-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
- (5S,6S,7S)-6-Hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
- 2-Butenoic Acid, 2-Methyl-, (5S,6S,7S,13As)-5,6,7,13A-Tetrahydro-6-Hydroxy-1,2,3,13-Tetramethoxy-6,7-Dimethylbenzo[3,4]Cycloocta[1,2-F][1,3]Benzodioxol-5-Yl Ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, (5S,6S,7S,13aS)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, stereoisomer
- 2-butenoic acid, 2-methyl-, (5R,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
- 2-butenoic acid, 2-methyl-, (5S,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
- Angeloygomisin Q
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 2-butenoic acid deriv.
- Schisantherin B
- Schizantherin B
- Wuweizi ester B
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Schisantherin B
CAS:Formula:C28H34O9Purity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:514.57Schisantherin B
CAS:1.Formula:C28H34O9Purity:99% - 99.06%Color and Shape:SolidMolecular weight:514.56Schisantherin b
CAS:Carboxylic acid with additional oxygen functionsFormula:C28H34O9Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:514.57Schizantherin B
CAS:Schizantherin B is a natural diterpenoid compound, which is isolated from the traditional Chinese medicinal plant Schizandra chinensis. It exhibits numerous biological activities due to its complex molecular structure. The primary mode of action of Schizantherin B involves modulation of multiple signaling pathways, which contributes to its anti-inflammatory, antioxidant, and neuroprotective effects. Researchers have also identified its role in inhibiting cell proliferation and inducing apoptosis in various cancer cell lines.Formula:C28H34O9Purity:Min. 95%Color and Shape:PowderMolecular weight:514.56 g/molSchisantherin B
CAS:Controlled ProductApplications Schisantherin B is a bioactive of lignans isolated from Schisandra chinesis which protect against cognitive deficits and neurodegeneration induced by Aβ1-42 in mice.
References Xu, M., et al.: Physiol. Behav., 167, 265-273 (2016)Formula:C28H34O9Color and Shape:NeatMolecular weight:514.562-BUTENOIC ACID, 2-METHYL-, (5S,6S,7S,13AS)-5,6,7,8-TETRAHYDRO-6-HYDROXY-1,2,3,13-TETRAMETHOXY-6,7-DIMETHYLBENZO[3,4]CYCLOOCTA[1,2-F][1,3]BENZODIOXOL-5-YL ESTER, (2Z)-
CAS:Formula:C28H34O9Purity:98%Color and Shape:SolidMolecular weight:514.5642Ref: IN-DA00EBE3
Discontinued product








