CAS 58546-55-7: Schisantherin B

Description:Schisantherin B is a natural compound classified as a lignan, primarily derived from the plant Schisandra chinensis, which is known for its medicinal properties. This compound exhibits a complex molecular structure characterized by multiple aromatic rings and hydroxyl groups, contributing to its biological activity. Schisantherin B has been studied for its potential antioxidant, anti-inflammatory, and hepatoprotective effects, making it of interest in pharmacological research. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is typical for lignans. Additionally, Schisantherin B may interact with various biological pathways, influencing cellular processes and exhibiting potential therapeutic benefits. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in herbal medicine and dietary supplements. Overall, Schisantherin B represents a significant compound in the field of natural products chemistry, with ongoing research aimed at fully elucidating its mechanisms of action and potential health benefits.

Formula:C₂₈H₃₄O₉

InChI:InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-18(31-5)22(32-6)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-19-23(24(20)33-7)36-13-35-19/h9,11-12,15,26,30H,10,13H2,1-8H3

InChI key:InChIKey=BKGUPIVDQHHVMV-UHFFFAOYSA-N

SMILES:O=C(OC1C=2C=C(OC)C(OC)=C(OC)C2C3=C(OC)C=4OCOC4C=C3CC(C)C1(O)C)C(=CC)C

Synonyms:
(5R,6S,7S)-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
(5S,6S,7S)-6-Hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
2-Butenoic Acid, 2-Methyl-, (5S,6S,7S,13As)-5,6,7,13A-Tetrahydro-6-Hydroxy-1,2,3,13-Tetramethoxy-6,7-Dimethylbenzo[3,4]Cycloocta[1,2-F][1,3]Benzodioxol-5-Yl Ester, (2Z)-
2-Butenoic acid, 2-methyl-, (5S,6S,7S,13aS)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, (2Z)-
2-Butenoic acid, 2-methyl-, 5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, stereoisomer
2-butenoic acid, 2-methyl-, (5R,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
2-butenoic acid, 2-methyl-, (5S,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
Angeloygomisin Q
Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 2-butenoic acid deriv.
Schisantherin B
See more synonyms
Schizantherin B
Wuweizi ester B
Gomisin B

Found 9 products.

Product data	Purity	Price range	Estimated delivery
2-BUTENOIC ACID, 2-METHYL-, (5S,6S,7S,13AS)-5,6,7,8-TETRAHYDRO-6-HYDROXY-1,2,3,13-TETRAMETHOXY-6,7-DIMETHYLBENZO[3,4]CYCLOOCTA[1,2-F][1,3]BENZODIOXOL-5-YL ESTER, (2Z)- REF: IN-DA00EBE3CAS: 58546-55-7	98%	74.00 €~494.00 €	Tue 15 Apr 25
Schisantherin B REF: 54-BUP03404CAS: 58546-55-7	99.06%	379.00 €~763.00 €	Wed 16 Apr 25
Schizantherin B REF: 7W-GY6336CAS: 58546-55-7	- - -	To inquire	Wed 16 Apr 25
Schizantherin B REF: BP-BP1268CAS: 58546-55-7	95%~99%	166.00 €~453.00 €	Mon 21 Apr 25
Schisantherin B REF: 3B-G0540CAS: 58546-55-7	>98.0%(HPLC)	98.00 €~330.00 €	Mon 21 Apr 25
Schisantherin B REF: TM-T6S1918CAS: 58546-55-7	99% - 99.06%	52.00 €~512.00 €	Tue 22 Apr 25
Schisantherin b REF: 5G-83542CAS: 58546-55-7	≥ 95.0 % (HPLC)	342.00 €~23,204.00 €	Thu 24 Apr 25
Schizantherin B REF: 3D-FS145269CAS: 58546-55-7	Min. 95%	145.00 €~881.00 €	Mon 28 Apr 25
Schisantherin B REF: TR-S199110CAS: 58546-55-7	- - -	119.00 €~683.00 €	Tue 27 May 25