CAS 58546-55-7

Schisantherin B

Description:

Schisantherin B is a natural compound classified as a lignan, primarily derived from the plant Schisandra chinensis, which is known for its medicinal properties. This compound exhibits a complex molecular structure characterized by multiple aromatic rings and hydroxyl groups, contributing to its biological activity. Schisantherin B has been studied for its potential antioxidant, anti-inflammatory, and hepatoprotective effects, making it of interest in pharmacological research. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is typical for lignans. Additionally, Schisantherin B may interact with various biological pathways, influencing cellular processes and exhibiting potential therapeutic benefits. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in herbal medicine and dietary supplements. Overall, Schisantherin B represents a significant compound in the field of natural products chemistry, with ongoing research aimed at fully elucidating its mechanisms of action and potential health benefits.

Formula: C₂₈H₃₄O₉

InChI: InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-18(31-5)22(32-6)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-19-23(24(20)33-7)36-13-35-19/h9,11-12,15,26,30H,10,13H2,1-8H3

InChI key: InChIKey=BKGUPIVDQHHVMV-UHFFFAOYSA-N

SMILES: O(C)C1=C2C=3C(=CC4=C(C3OC)OCO4)CC(C)C(C)(O)C(OC(C(=CC)C)=O)C2=CC(OC)=C1OC

Synonyms:

• (5R,6S,7S)-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
• (5S,6S,7S)-6-Hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate
• 2-Butenoic Acid, 2-Methyl-, (5S,6S,7S,13As)-5,6,7,13A-Tetrahydro-6-Hydroxy-1,2,3,13-Tetramethoxy-6,7-Dimethylbenzo[3,4]Cycloocta[1,2-F][1,3]Benzodioxol-5-Yl Ester, (2Z)-
• 2-Butenoic acid, 2-methyl-, (5S,6S,7S,13aS)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, (2Z)-
• 2-Butenoic acid, 2-methyl-, 5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, stereoisomer
• 2-butenoic acid, 2-methyl-, (5R,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
• 2-butenoic acid, 2-methyl-, (5S,6S,7S)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl ester, (2Z)-
• Angeloygomisin Q
• Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 2-butenoic acid deriv.
• Schisantherin B
• Schizantherin B
• Wuweizi ester B

Schizantherin B

CAS: 58546-55-7

Formula: C₂₈H₃₄O₉

Molecular weight: 514.57

Ref: 7W-GY6336

Schisantherin B

CAS: 58546-55-7

Schisantherin B

Purity: ≥98%

Molecular weight: 514.56g/mol

Ref: 54-BUP03404

Schisantherin B

CAS: 58546-55-7

Formula: C₂₈H₃₄O₉

Purity: >98.0%(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 514.57

Ref: 3B-G0540

Schizantherin B

CAS: 58546-55-7

Formula: C₂₈H₃₄O₉

Purity: 95%~99%

Molecular weight: 514.571

Ref: BP-BP1268

Schisantherin B

CAS: 58546-55-7

1.

Formula: C₂₈H₃₄O₉

Purity: 99% - 99.06%

Color and Shape: Solid

Molecular weight: 514.56

Ref: TM-T6S1918

Schisantherin b

CAS: 58546-55-7

Carboxylic acid with additional oxygen functions

Formula: C₂₈H₃₄O₉

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 514.57

Ref: 5G-83542

Schizantherin B

CAS: 58546-55-7

Schizantherin B is a natural diterpenoid compound, which is isolated from the traditional Chinese medicinal plant Schizandra chinensis. It exhibits numerous biological activities due to its complex molecular structure. The primary mode of action of Schizantherin B involves modulation of multiple signaling pathways, which contributes to its anti-inflammatory, antioxidant, and neuroprotective effects. Researchers have also identified its role in inhibiting cell proliferation and inducing apoptosis in various cancer cell lines.

Formula: C₂₈H₃₄O₉

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 514.56 g/mol

Ref: 3D-FS145269

Schisantherin B

Controlled Product

CAS: 58546-55-7

Applications Schisantherin B is a bioactive of lignans isolated from Schisandra chinesis which protect against cognitive deficits and neurodegeneration induced by Aβ1-42 in mice.
References Xu, M., et al.: Physiol. Behav., 167, 265-273 (2016)

Formula: C₂₈H₃₄O₉

Color and Shape: Neat

Molecular weight: 514.56

Ref: TR-S199110

2-BUTENOIC ACID, 2-METHYL-, (5S,6S,7S,13AS)-5,6,7,8-TETRAHYDRO-6-HYDROXY-1,2,3,13-TETRAMETHOXY-6,7-DIMETHYLBENZO[3,4]CYCLOOCTA[1,2-F][1,3]BENZODIOXOL-5-YL ESTER, (2Z)-

CAS: 58546-55-7

Formula: C₂₈H₃₄O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 514.5642

Ref: IN-DA00EBE3