CAS 58546-89-7
:1-benzofuran-5-amine
Description:
1-Benzofuran-5-amine, with the CAS number 58546-89-7, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features an amino group (-NH2) at the 5-position of the benzofuran ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents due to the presence of the amino group. 1-Benzofuran-5-amine may exhibit properties such as being a potential intermediate in organic synthesis or a building block for pharmaceuticals, particularly in the development of compounds with medicinal properties. Its reactivity can be attributed to the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many amines, it may also exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H7NO
InChI:InChI=1/C8H7NO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H,9H2
SMILES:c1cc2c(cco2)cc1N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Aminobenzo[b]furan
CAS:5-Aminobenzo[b]furanFormula:C8H7NOPurity:95%Color and Shape: orange liquidMolecular weight:133.15g/mol1-Benzofuran-5-amine
CAS:1-Benzofuran-5-amine is an organic solvent that is used as a synthetic intermediate in the synthesis of quinoline derivatives and methoxy groups. It has been shown to have potent antibacterial activity against Gram-positive bacteria. 1-Benzofuran-5-amine can be used as an antimicrobial agent in oral baths (e.g., foot bath) at concentrations of 15 mg/l or higher, with a contact time of 20 minutes or longer. The drug has also been shown to have long acting properties, which may be due to its ability to inhibit nitric oxide production.Formula:C8H7NOPurity:Min. 95%Molecular weight:133.15 g/mol






