CAS 58549-95-4

2,5-Bis(chloromethyl)pyrazine

Description:

2,5-Bis(chloromethyl)pyrazine is a heterocyclic organic compound characterized by a pyrazine ring with two chloromethyl groups attached at the 2 and 5 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of chloromethyl groups, which can undergo nucleophilic substitution reactions, making it useful in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The compound is moderately soluble in organic solvents but has limited solubility in water. Safety precautions are necessary when handling this substance, as it may pose health risks due to its chlorinated nature. Proper storage in a cool, dry place away from light is recommended to maintain its stability. Overall, 2,5-Bis(chloromethyl)pyrazine is a valuable compound in synthetic organic chemistry, particularly in the development of more complex molecular structures.

Formula: C₆H₆Cl₂N₂

InChI: InChI=1S/C6H6Cl2N2/c7-1-5-3-10-6(2-8)4-9-5/h3-4H,1-2H2

InChI key: InChIKey=OUIUTOQNQNHRKC-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=NC(CCl)=CN1

Synonyms:

• 2,5-Bis(chloromethyl)pyrazine
• Pyrazine, 2,5-bis(chloromethyl)-

2,5-Bis(chloromethyl)-pyrazine

CAS: 58549-95-4

2,5-Bis(chloromethyl)pyrazine is a coordination complex that contains two pyrazine ligands. The compound is an isomer of 2,5-bis(chloromethyl)pyridine and has the same geometry as the pyridine molecule. This complex exists in two different isomeric forms: one with two chlorines on opposite sides of the pyrazine ring and the other with two chlorines on adjacent positions. The alkoxides are symmetric, polymeric structures that can be made by reacting acetals with acetals or pyridines with ligands.

Formula: C₆H₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 177.03 g/mol

Ref: 3D-ICA54995