CAS 5855-52-7
:2-phenylquinolin-4-amine
Description:
2-Phenylquinolin-4-amine, with the CAS number 5855-52-7, is an organic compound that belongs to the class of quinoline derivatives. It features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring, with an amino group (-NH2) and a phenyl group (-C6H5) attached to the quinoline structure. This compound is characterized by its potential biological activity, making it of interest in medicinal chemistry and drug development. It may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory effects, although specific biological activities can vary based on structural modifications and the presence of substituents. The compound is typically solid at room temperature and may have moderate solubility in organic solvents. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C15H12N2
InChI:InChI=1/C15H12N2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H,(H2,16,17)
SMILES:c1ccc(cc1)c1cc(c2ccccc2n1)N
Synonyms:- 2-Phenyl-4-aminoquinoline
- 2-Phenyl-4-quinolinamine
- 4-Quinolinamine, 2-phenyl-
- Quinoline, 4-amino-2-phenyl-
- 1-Phenyl-5-aminotetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Phenylquinolin-4-amine
CAS:2-Phenylquinolin-4-amine is a ligand that binds to the active site of the human apoE4 protein, which is involved in lipid metabolism. 2-Phenylquinolin-4-amine has been shown to be cytotoxic against cancer cell lines and potent at low concentrations. It was also shown to have potent activity in apoptosis induction and cell cycle arrest. This ligand interacts with amide groups on the surface of proteins and can form amide bonds with other molecules, including formamide and solvents. The binding constants for 2-phenylquinolin-4-amine have been measured using molecular modeling techniques and bioinformatics databases.
Formula:C15H12N2Purity:Min. 95%Molecular weight:220.28 g/mol

