CAS 5855-56-1
:2-chloro-4-phenylquinoline
Description:
2-Chloro-4-phenylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 2-position and a phenyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and organic synthesis. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to its hydrophobic nature. The chlorine substituent can influence the compound's reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, 2-chloro-4-phenylquinoline may exhibit biological activity, which has been the subject of research in medicinal chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound represents an interesting subject for further study in both synthetic and medicinal chemistry contexts.
Formula:C15H10ClN
InChI:InChI=1/C15H10ClN/c16-15-10-13(11-6-2-1-3-7-11)12-8-4-5-9-14(12)17-15/h1-10H
SMILES:c1ccc(cc1)c1cc(Cl)nc2ccccc12
Synonyms:- Quinoline, 2-Chloro-4-Phenyl-
- 2-Chloro-4-phenylquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chloro-4-phenylquinoline
CAS:Formula:C15H10ClNPurity:97%Color and Shape:SolidMolecular weight:239.69962-Chloro-4-phenylquinoline
CAS:2-Chloro-4-phenylquinoline is a chemical compound that has been identified in the straw of triticum aestivum. It has been shown to interact with amino acids in vitro, and may have an effect on protein synthesis. 2-Chloro-4-phenylquinoline is also toxic to microbes and can be used as a herbicide. In vitro studies have shown that 2-chloro-4-phenylquinoline inhibits microbial metabolism by inhibiting propionate production, thereby leading to lower levels of fatty acid and faeces.Formula:C15H10ClNPurity:Min. 95%Molecular weight:239.7 g/mol


