CAS 5855-78-7

5-Amino-2-chloro-4-sulfobenzoic acid

Description:

5-Amino-2-chloro-4-sulfobenzoic acid, with the CAS number 5855-78-7, is an aromatic sulfonic acid derivative characterized by the presence of an amino group, a chloro substituent, and a sulfonic acid group on a benzoic acid framework. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions in various chemical environments. It is often used in organic synthesis, particularly in the preparation of dyes and pigments, owing to its functional groups that allow for further chemical modifications. Additionally, the presence of the chlorine atom can introduce unique reactivity patterns, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards.

Formula: C₇H₆ClNO₅S

InChI: InChI=1S/C7H6ClNO5S/c8-4-2-6(15(12,13)14)5(9)1-3(4)7(10)11/h1-2H,9H2,(H,10,11)(H,12,13,14)

InChI key: InChIKey=JGSAMPZLJLDOKW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(N)C=C(C(O)=O)C(Cl)=C1

Synonyms:

• 5-Amino-2-chloro-4-sulfobenzoic acid
• Benzoic acid, 5-amino-2-chloro-4-sulfo-
• 3-Amino-6-chloro-4-sulfobenzoic acid