CAS 58584-94-4
:2,6-Dichloro-3-methylpyridine
Description:
2,6-Dichloro-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methyl group. Its molecular formula is C7H6Cl2N, indicating the presence of carbon, hydrogen, chlorine, and nitrogen atoms. The compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a distinctive aromatic odor and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. 2,6-Dichloro-3-methylpyridine is primarily used in the synthesis of agrochemicals, pharmaceuticals, and other fine chemicals. It exhibits biological activity, making it of interest in medicinal chemistry. However, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its reactivity is influenced by the presence of the chlorine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions.
Formula:C6H5Cl2N
InChI:InChI=1/C6H5Cl2N/c1-4-2-3-5(7)9-6(4)8/h2-3H,1H3
SMILES:Cc1ccc(Cl)nc1Cl
Synonyms:- Pyridine, 2,6-Dichloro-3-Methyl-
- 2,6-Dichloro-3-methylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Dichloro-3-methylpyridine, 98%
CAS:2,6-Dichloro-3-methylpyridine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information
Formula:C6H5Cl2NPurity:98%Molecular weight:162.012,6-Dichloro-3-methylpyridine
CAS:Formula:C6H5Cl2NPurity:95%Color and Shape:SolidMolecular weight:162.01662,6-Dichloro-3-methylpyridine
CAS:2,6-Dichloro-3-methylpyridinePurity:98%Molecular weight:162.02g/mol2,6-Dichloro-3-methylpyridine
CAS:Formula:C6H5Cl2NPurity:95%Color and Shape:Light yellow powderMolecular weight:162.01



