CAS 58599-05-6

3-(5-methyl-1,2,4-oxadiazol-3-yl)phenol

Description:

3-(5-methyl-1,2,4-oxadiazol-3-yl)phenol, with the CAS number 58599-05-6, is an organic compound characterized by the presence of a phenolic group and a 1,2,4-oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, which may include antimicrobial or antifungal effects, owing to the oxadiazole ring's ability to interact with biological systems. The presence of the methyl group on the oxadiazole enhances its lipophilicity, potentially influencing its reactivity and interaction with other molecules. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, which may affect its solubility and stability in various environments. The compound's structure suggests it could be of interest in pharmaceutical or agricultural applications, particularly in the development of new drugs or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate any potential hazards associated with its use.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-6-10-9(11-13-6)7-3-2-4-8(12)5-7/h2-5,12H,1H3

SMILES: Cc1nc(c2cccc(c2)O)no1

Synonyms:

• Phenol, 3-(5-Methyl-1,2,4-Oxadiazol-3-Yl)-

3-(5-Methyl-1,2,4-oxadiazol-3-yl)phenol

CAS: 58599-05-6

Versatile small molecule scaffold

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Molecular weight: 176.17 g/mol

Ref: 3D-ICA59905