CAS 5860-70-8
:2-carbamoylpyridine-3-carboxylic acid
Description:
2-Carbamoylpyridine-3-carboxylic acid, with the CAS number 5860-70-8, is an organic compound that features a pyridine ring substituted with both a carbamoyl group and a carboxylic acid group. This compound typically exhibits characteristics common to pyridine derivatives, such as being a polar, water-soluble substance due to the presence of the carboxylic acid functional group. The carbamoyl group contributes to its potential as a ligand in coordination chemistry and may enhance its biological activity. The presence of both functional groups allows for various chemical reactivity, including potential hydrogen bonding and participation in acid-base reactions. Additionally, this compound may exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the pH of the environment. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, particularly in the development of biologically active compounds.
Formula:C7H6N2O3
InChI:InChI=1/C7H6N2O3/c8-6(10)5-4(7(11)12)2-1-3-9-5/h1-3H,(H2,8,10)(H,11,12)
SMILES:c1cc(c(C(=N)O)nc1)C(=O)O
Synonyms:- 2-Carbamoylnicotinic acid
- 3-Pyridinecarboxylic Acid, 2-(Aminocarbonyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Aminocarbonyl)nicotinic acid
CAS:Formula:C7H6N2O3Purity:97%Color and Shape:SolidMolecular weight:166.13412-Aminocarbonylnicotinic acid
CAS:<p>2-Aminocarbonylnicotinic acid is a nicotinic acid amide with a 3-quinolinecarboxylic acid moiety. It is synthesized by the reaction of isocyanates and succinamide, followed by cyclization. 2-Aminocarbonylnicotinic acid has been used to produce benzoic acids, amides, and dicarboxylic acids. This compound has also been shown to be an effective inhibitor of bacterial growth in vitro. 2-Aminocarbonylnicotinic acid is an unsubstituted molecule that can be used as a starting material for the synthesis of other compounds.</p>Formula:C7H6N2O3Purity:Min. 95%Molecular weight:166.13 g/mol


