CAS 58607-69-5
:D-phenylalanyl-D-phenylalanine
Description:
D-phenylalanyl-D-phenylalanine, with the CAS number 58607-69-5, is a dipeptide composed of two D-phenylalanine residues. This compound is characterized by its structure, which features two phenylalanine amino acids linked by a peptide bond, both in their D-configuration. D-phenylalanine is a non-polar, aromatic amino acid known for its role in protein synthesis and its potential applications in various biochemical contexts. The presence of two D-amino acids in this dipeptide can influence its biological activity, stability, and resistance to enzymatic degradation compared to L-amino acids. This compound may exhibit unique properties in terms of solubility, melting point, and interaction with biological systems, making it of interest in research related to peptide synthesis, drug design, and neurobiology. Additionally, D-phenylalanine has been studied for its potential analgesic effects and role in modulating mood, highlighting the importance of stereochemistry in biological activity.
Formula:C18H20N2O3
InChI:InChI=1/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23)/t15-,16-/m1/s1
SMILES:c1ccc(cc1)C[C@H](C(=N[C@H](Cc1ccccc1)C(=O)O)O)N
Synonyms:- D-phenylalanine, D-phenylalanyl-
- H-D-Phe-D-Phe-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
H-D-Phe-D-Phe-OH
CAS:D-Phe-D-Phe forms enzymatically stable nanotubes from HFIP solution.Formula:C18H20N2O3Purity:≥ 98%Color and Shape:White PowderMolecular weight:312.37(R)-2-((R)-2-Amino-3-phenylpropanamido)-3-phenylpropanoic acid
CAS:(R)-2-((R)-2-Amino-3-phenylpropanamido)-3-phenylpropanoic acidPurity:95%Molecular weight:312.37g/molD-Phenylalaninyl-D-Phenylalanine-d5
CAS:Formula:C18H15D5N2O3Color and Shape:White To Off-White SolidMolecular weight:317.40D-Phenylalaninyl-D-Phenylalanine
CAS:Formula:C18H20N2O3Color and Shape:White To Off-White SolidMolecular weight:312.37(R)-2-((R)-2-Amino-3-phenylpropanamido)-3-phenylpropanoic acid
CAS:Formula:C18H20N2O3Purity:95%Color and Shape:Solid, White powderMolecular weight:312.369H-D-Phe-D-Phe-OH
CAS:H-D-Phe-D-Phe-OH is a polypeptide that contains 24 amino acids. It is synthesized by the filamentous fungus, Aspergillus niger, and has been found to be an optimal substrate for aminopeptidase. H-D-Phe-D-Phe-OH has also been shown to be a homolog of the halophilic enzyme from Halobacterium salinarum.
Formula:C18H20N2O3Purity:Min. 95%Molecular weight:312.36 g/molRef: 3D-FP108253
Discontinued product






