CymitQuimica logo

CAS 58607-90-2

:

ethyl 5-oxo-4,5-dihydro-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-oxo-4,5-dihydro-1H-pyrazole-3-carboxylate, identified by its CAS number 58607-90-2, is a chemical compound that belongs to the class of pyrazole derivatives. This substance typically features a pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a carboxylate group and an oxo group contributes to its reactivity and potential applications in organic synthesis. Ethyl 5-oxo-4,5-dihydro-1H-pyrazole-3-carboxylate is often characterized by its ability to participate in various chemical reactions, including condensation and cyclization, making it valuable in the development of pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Overall, this compound is of interest in medicinal chemistry due to its structural features that may lead to biological activity.
Formula:C6H8N2O3
InChI:InChI=1/C6H8N2O3/c1-2-11-6(10)4-3-5(9)8-7-4/h2-3H2,1H3,(H,8,9)
InChI key:KNWNWWDKWKYUBB-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NN=C(C1)O
Synonyms:
  • 1H-pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-, ethyl ester
  • Ethyl 5-oxo-4,5-dihydro-1H-pyrazole-3-carboxylate
Found 4 products.