CAS 58616-25-4
:4-({[4-({[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}amino)-1H-pyrrol-2-yl]carbonyl}amino)-N-[(3Z)-3-amino-3-iminopropyl]-1-methyl-1H-pyrrole-2-carboxamide
Description:
The chemical substance with the name "4-({[4-({[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}amino)-1H-pyrrol-2-yl]carbonyl}amino)-N-[(3Z)-3-amino-3-iminopropyl]-1-methyl-1H-pyrrole-2-carboxamide" and CAS number "58616-25-4" is a complex organic compound characterized by multiple functional groups, including amines, amides, and pyrrole rings. Its structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of amino and carbonyl groups that can participate in various biochemical interactions. The compound's molecular framework indicates it may exhibit properties such as solubility in polar solvents, stability under physiological conditions, and the ability to form hydrogen bonds, which are crucial for its interaction with biological targets. Additionally, the stereochemistry indicated by the (2S) configuration suggests chirality, which can influence the compound's pharmacodynamics and pharmacokinetics. Overall, this substance's intricate structure and functional diversity make it a candidate for further investigation in medicinal chemistry and drug development.
Formula:C19H25N9O3
InChI:InChI=1/C19H25N9O3/c1-28-9-11(7-14(28)19(31)23-5-4-15(20)21)26-18(30)13-6-10(8-24-13)25-17(29)12-2-3-16(22)27-12/h6-9,12,24H,2-5H2,1H3,(H3,20,21)(H2,22,27)(H,23,31)(H,25,29)(H,26,30)/t12-/m0/s1
Synonyms:- 1H-pyrrole-2-carboxamide, 4-[[[4-[[[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl]amino]-1H-pyrrol-2-yl]carbonyl]amino]-N-(3-amino-3-iminopropyl)-1-methyl-
- 4-({[4-({[(2S)-5-amino-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}amino)-1H-pyrrol-2-yl]carbonyl}amino)-N-(3-amino-3-iminopropyl)-1-methyl-1H-pyrrole-2-carboxamide
- Anthelvencin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Anthelvencin A
CAS:Anthelvencin A is a pyrrolylamide metabolite with moderate antibacterial and anthelmintic activity.Formula:C19H25N9O3Color and Shape:SolidMolecular weight:427.46
