CAS 58633-04-8

4-amino-3,5-dibromobenzonitrile

Description:

4-Amino-3,5-dibromobenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), two bromine atoms, and a nitrile group (-C≡N) attached to a benzene ring. This compound features a benzene ring substituted at the 4-position with an amino group and at the 3 and 5 positions with bromine atoms. The presence of the nitrile group contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like 4-amino-3,5-dibromobenzonitrile exhibit moderate to high polarity due to the electronegative bromine atoms and the nitrile group, which can influence their solubility in various solvents. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's physical properties, such as melting and boiling points. This compound may be utilized in various chemical reactions, including nucleophilic substitutions and as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as brominated compounds can pose health risks.

Formula: C₇H₄Br₂N₂

InChI: InChI=1/C7H4Br2N2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2H,11H2

SMILES: c1c(cc(c(c1Br)N)Br)C#N

Synonyms:

• Benzonitrile, 4-amino-3,5-dibromo-
• Zr Be Fe Dcn [Wln]

4-AMINO-3,5-DIBROMOBENZONITRILE

CAS: 58633-04-8

Formula: C₇H₄Br₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 275.9281

Ref: IN-DA00EBQB

4-Amino-3,5-dibromobenzonitrile

CAS: 58633-04-8

4-Amino-3,5-dibromobenzonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 275.93g/mol

Ref: 54-OR7253

4-Amino-3,5-dibromobenzonitrile

CAS: 58633-04-8

Formula: C₇H₄Br₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 275.931

Ref: 10-F024449