CAS 5864-79-9

3-hydroxy-2-phenyl-cyclopent-2-en-1-one

Description:

3-Hydroxy-2-phenyl-cyclopent-2-en-1-one, with the CAS number 5864-79-9, is an organic compound characterized by its cyclopentene structure, which features a phenyl group and a hydroxyl functional group. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a building block in the development of various pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its reactivity, allowing for hydrogen bonding and influencing its solubility in polar solvents. Additionally, the conjugated double bond system in the cyclopentene ring can provide interesting electronic properties, making it a subject of study in materials science and organic chemistry. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, which can affect its potential applications in different chemical reactions. Overall, 3-hydroxy-2-phenyl-cyclopent-2-en-1-one is a versatile compound with notable chemical characteristics.

Formula: C₁₁H₁₀O₂

InChI: InChI=1/C11H10O2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h1-5,12H,6-7H2

SMILES: c1ccc(cc1)C1=C(CCC1=O)O

Synonyms:

• 2-Cyclopenten-1-One, 3-Hydroxy-2-Phenyl-
• 3-Hydroxy-2-phenylcyclopent-2-en-1-one
• 3-Hydroxy-2-phenyl-cyclopent-2-enon
• e
• 3-Hydroxy-2-phenylcyclopent-2-enone
• 5864-79-9

3-Hydroxy-2-phenylcyclopent-2-enone

CAS: 5864-79-9

Formula: C₁₁H₁₀O₂

Color and Shape: Solid

Molecular weight: 174.1959

Ref: IN-DA00EBJQ

3-Hydroxy-2-phenylcyclopent-2-en-1-one

CAS: 5864-79-9

The herbicide 3-Hydroxy-2-phenylcyclopent-2-en-1-one is a phenoxy compound that inhibits the enzyme acetolactate synthase, which is required for the biosynthesis of branched chain amino acids. This inhibition leads to a shortage of these amino acids and growth inhibition in plants.

Formula: C₁₁H₁₀O₂

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-FAA86479