CAS 58644-55-6
:3-(isocyanomethyl)pyridine
Description:
3-(Isocyanomethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the isocyanomethyl group at the 3-position of the pyridine ring introduces unique reactivity and properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the isocyanate functional group that can participate in various chemical reactions, such as nucleophilic addition and cycloaddition. The compound is also of interest in materials science for its potential use in polymer chemistry. Safety considerations are important, as isocyanates can be toxic and irritating to the respiratory system and skin. Proper handling and storage in a well-ventilated area with appropriate personal protective equipment are essential when working with this substance.
Formula:C7H6N2
InChI:InChI=1/C7H6N2/c1-8-5-7-3-2-4-9-6-7/h2-4,6H,5H2
SMILES:[C-]#[N+]Cc1cccnc1
Synonyms:- Pyridine, 3-(isocyanomethyl)-
- 3-(Isocyanomethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Isocyanomethyl)pyridine
CAS:3-(Isocyanomethyl)pyridine is a nucleophilic amine that is used in organic chemistry as a reagent. It can be used either as a primary amine or as an isocyanide, depending on the desired functionality. 3-(Isocyanomethyl)pyridine reacts with electrophiles such as phenols, alcohols, and carboxylic acids to form reactive intermediates. These intermediates are often useful for generating new molecules. 3-(Isocyanomethyl)pyridine is also capable of reacting with primary and secondary amines to yield multigram quantities of products.
3-(Isocyanomethyl)pyridine has been shown to be an innovative chemical that can be used in many different applications.Formula:C7H6N2Purity:Min. 95%Molecular weight:118.14 g/molRef: 3D-ICA64455
Discontinued product


