CAS 5866-98-8
:2,6-Dichloro-3-nitrobenzonitrile
Description:
2,6-Dichloro-3-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms, a nitro group, and a cyano group. The presence of the dichloro and nitro substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically appears as a solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents. Its molecular structure imparts specific electronic properties, making it a useful intermediate in organic synthesis. Additionally, 2,6-Dichloro-3-nitrobenzonitrile may exhibit biological activity, which can be explored for potential use in drug development or as a pesticide. Safety precautions are necessary when handling this compound, as it may pose health risks, including toxicity. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C7H2Cl2N2O2
InChI:InChI=1S/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H
InChI key:InChIKey=NSKVWZIEYFSHIM-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Cl)C(N(=O)=O)=CC=C1Cl
Synonyms:- 3-Nitro-2,6-dichlorobenzonitrile
- 2,6-Dichloro-3-nitrobenzonitrile
- Benzonitrile, 2,6-dichloro-3-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Dichloro-3-nitrobenzonitrile
CAS:2,6-Dichloro-3-nitrobenzonitrilePurity:98%Molecular weight:217.01g/mol2,6-Dichloro-3-nitrobenzonitrile
CAS:2,6-Dichloro-3-nitrobenzonitrile is a chemical compound that has been synthesized by optimising the potentials of monoclonal antibodies. It has shown to have high affinity for rat brain membranes and is also able to bind to the target molecule with high affinity. 2,6-Dichloro-3-nitrobenzonitrile can be used as a pesticide and has been shown to have an affinity for the target molecule with high affinity. This chemical compound is trisubstituted and has three nitro groups, which are all located in the same position on the benzene ring. The structure of this chemical compound is optimized, meaning that it has been modified so that its physical properties are more desirable than its original form.
Formula:C7H2Cl2N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:217.01 g/mol


