CAS 58668-41-0

N'-(4-formyl-3-methyl-1-phenyl-1H-pyrazol-5-yl)-N,N-dimethylimidoformamide

Description:

N'-(4-formyl-3-methyl-1-phenyl-1H-pyrazol-5-yl)-N,N-dimethylimidoformamide, identified by its CAS number 58668-41-0, is a chemical compound characterized by its complex structure, which includes a pyrazole ring and an imidoformamide moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the aldehyde functional group. The pyrazole ring contributes to its stability and may influence its solubility in various solvents. Additionally, the dimethylamino group enhances its nucleophilicity, making it a candidate for various chemical reactions, including condensation and substitution reactions. The presence of multiple functional groups suggests that it may exhibit interesting biological activities, although specific biological data would need to be referenced for detailed insights. Overall, this compound's unique structure and functional groups make it a subject of interest in synthetic organic chemistry and potentially in medicinal chemistry.

Formula: C₁₄H₁₆N₄O

InChI: InChI=1/C14H16N4O/c1-11-13(9-19)14(15-10-17(2)3)18(16-11)12-7-5-4-6-8-12/h4-10H,1-3H3

SMILES: Cc1c(C=O)c(N=CN(C)C)n(c2ccccc2)n1

Synonyms:

• N'-(4-formyl-3-methyl-1-phenyl-1H-pyrazol-5-yl)-N,N-dimethyliminoformamide

(E)-N'-(4-Formyl-3-methyl-1-phenyl-1H-pyrazol-5-yl)-N,N-dimethylmethanimidamide

CAS: 58668-41-0

(E)-N'-(4-Formyl-3-methyl-1-phenyl-1H-pyrazol-5-yl)-N,N-dimethylmethanimidamide

Purity: 95%

Molecular weight: 256.30g/mol

Ref: 54-OR32099