CAS 58677-34-2

4-methyl-1,2,5-oxadiazole-3-carboxylic acid

Description:

4-Methyl-1,2,5-oxadiazole-3-carboxylic acid is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the 4-position of the oxadiazole ring influences its chemical reactivity and solubility. Typically, compounds like this exhibit moderate polarity due to the functional groups present, which can affect their interactions in biological systems and their solubility in various solvents. The oxadiazole ring is known for its stability and potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Its CAS number, 58677-34-2, allows for precise identification in chemical databases and literature. Overall, 4-methyl-1,2,5-oxadiazole-3-carboxylic acid is a valuable compound in various fields of chemistry and material science.

Formula: C₄H₄N₂O₃

InChI: InChI=1/C4H4N2O3/c1-2-3(4(7)8)6-9-5-2/h1H3,(H,7,8)

SMILES: Cc1c(C(=O)O)non1

Synonyms:

• 1,2,5-Oxadiazole-3-carboxylic acid, 4-methyl-

4-Methyl-1,2,5-oxadiazole-3-carboxylic acid

CAS: 58677-34-2

Formula: C₄H₄N₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 128.0862

Ref: IN-DA00EDVP

4-Methyl-1,2,5-oxadiazole-3-carboxylic acid

CAS: 58677-34-2

4-Methyl-1,2,5-oxadiazole-3-carboxylic acid

Purity: 98%

Molecular weight: 128.09g/mol

Ref: 54-OR54696

4-Methyl-1,2,5-oxadiazole-3-carboxylic acid

CAS: 58677-34-2

Purity: 96%

Molecular weight: 128.0870056

Ref: 10-F608781

4-​Methyl-​1,​2,​5-​oxadiazole-​3-​carboxylic Acid

Controlled Product

CAS: 58677-34-2

Formula: C₄H₄N₂O₃

Color and Shape: Neat

Molecular weight: 128.09

Ref: TR-M336143

4-Methylfurazan-3-carboxylic acid

CAS: 58677-34-2

4-Methylfurazan-3-carboxylic acid is a cyanogen compound that has been shown to cause vasodilatation of the sinusoid and hepatic steatosis. It is also reactive with lesion sites and can be used as a histological reagent. 4-Methylfurazan-3-carboxylic acid reacts with hydrazide to produce an acid hydrazide, which is also reactive. This compound has been shown to have therapeutic effects on hepatic steatosis in rats, but it does not exhibit any inhibitory effects on intestinal steatosis.

Formula: C₄H₄N₂O₃

Purity: Min. 95%

Molecular weight: 128.09 g/mol

Ref: 3D-ICA67734