CAS 58699-62-0
:3′-Azido-3′-deoxyadenosine
Description:
3′-Azido-3′-deoxyadenosine (CAS 58699-62-0) is a nucleoside analog of adenosine, characterized by the presence of an azido group at the 3′ position of the ribose sugar, replacing the hydroxyl group typically found in natural nucleosides. This modification imparts unique properties, making it a subject of interest in antiviral and anticancer research. The azido group enhances the compound's stability and resistance to enzymatic degradation, which is crucial for its potential therapeutic applications. 3′-Azido-3′-deoxyadenosine can be phosphorylated to its triphosphate form, allowing it to be incorporated into nucleic acids, thereby interfering with viral replication processes. Its mechanism of action is primarily attributed to its ability to inhibit reverse transcriptase, making it relevant in the context of HIV treatment. Additionally, the compound exhibits cytotoxic effects on certain cancer cell lines, highlighting its potential as an anticancer agent. Overall, 3′-Azido-3′-deoxyadenosine is a significant compound in medicinal chemistry, particularly in the development of antiviral and anticancer therapies.
Formula:C10H12N8O3
InChI:InChI=1S/C10H12N8O3/c11-8-6-9(14-2-13-8)18(3-15-6)10-7(20)5(16-17-12)4(1-19)21-10/h2-5,7,10,19-20H,1H2,(H2,11,13,14)/t4-,5-,7-,10-/m1/s1
InChI key:InChIKey=HTWSTKVLFZRAPM-QYYRPYCUSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](CO)[C@H]1N=[N+]=[N-]
Synonyms:- Adenosine, 3′-azido-3′-deoxy-
- 3′-Azido-3′-deoxyadenosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3'-Azido-3'-deoxyadenosine
CAS:3'-Azido-3'-deoxyadenosine is a Azido-nucleoside; 3'-N-Modified nucleoside.Formula:C10H12N8O3Color and Shape:SolidMolecular weight:292.25Ref: TM-TNU0147
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3'-Azido-3'-deoxyadenosine
CAS:3'-Azido-3'-deoxyadenosine is an initiator that can be used in oligoribonucleotide synthesis. It is stable, nonhydrolyzable and does not require any protecting groups for its use. 3'-Azido-3'-deoxyadenosine is efficient at initiating the synthesis of ribosomal RNA and has been shown to be a good substrate for biochemical studies. This compound is functionalized with a ribose group, which can be linked to other substances. The linkage of this compound to other substances allows it to be used as a building block for the production of oligoribonucleotides.
Formula:C10H12N8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:292.25 g/mol3′-Azido-3′-deoxyAdenosine
CAS:Controlled ProductFormula:C10H12N8O3Color and Shape:NeatMolecular weight:292.254


