CAS 587-64-4
:(3,5-dichlorophenoxy)acetic acid
Description:
(3,5-Dichlorophenoxy)acetic acid, commonly referred to as dicamba, is a synthetic herbicide primarily used for controlling broadleaf weeds in various crops. It belongs to the class of compounds known as phenoxy acids, characterized by a phenolic ring substituted with chlorine atoms and an acetic acid moiety. The molecular structure features two chlorine atoms at the 3 and 5 positions of the phenoxy ring, which enhances its herbicidal activity. Dicamba is a systemic herbicide, meaning it is absorbed by the plant and translocated throughout its tissues, effectively targeting growth processes. It acts by mimicking the natural plant hormone auxin, leading to uncontrolled growth and eventual plant death. Dicamba is typically applied in agricultural settings, but its use is regulated due to potential environmental impacts, including drift to non-target plants. Its solubility in water and organic solvents allows for various formulation types, including liquid concentrates and granules. Safety measures are essential when handling dicamba, as it can pose risks to non-target species and ecosystems.
Formula:C8H6Cl2O3
InChI:InChI=1/C8H6Cl2O3/c9-5-1-6(10)3-7(2-5)13-4-8(11)12/h1-3H,4H2,(H,11,12)
SMILES:c1c(cc(cc1Cl)OCC(=O)O)Cl
Synonyms:- Acetic acid, (3,5-dichlorophenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(3,5-Dichlorophenoxy)acetic acid
CAS:<p>2-(3,5-Dichlorophenoxy)acetic acid</p>Purity:97%Molecular weight:221.04g/mol2-(3,5-Dichlorophenoxy)acetic acid
CAS:<p>2-(3,5-Dichlorophenoxy)acetic acid is an organic compound that has both a carboxylate and a hydroxyl group. It is used as an herbicide and has been shown to be effective in preventing uptake of radioactive elements by plants. 2-(3,5-Dichlorophenoxy)acetic acid can be prepared from butanoic acid and sodium chloride. The molecular formula for 2-(3,5-Dichlorophenoxy)acetic acid is CHClOOC(CHCOCH).</p>Formula:C8H6O3Cl2Purity:Min. 95%Molecular weight:221.03 g/mol
