CAS 58717-24-1
:(4R,7R,8R,9E,14E,16E,18S,20R)-18,20-Dihydroxy-4,8,16-trimethyl-7-(1-methylethyl)-6,23-dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-9,14,16,22(25),24-pentaene-2,5,11-trione
Description:
The chemical substance with the name "(4R,7R,8R,9E,14E,16E,18S,20R)-18,20-Dihydroxy-4,8,16-trimethyl-7-(1-methylethyl)-6,23-dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-9,14,16,22(25),24-pentaene-2,5,11-trione" and CAS number "58717-24-1" is a complex organic compound characterized by its intricate bicyclic structure and multiple functional groups. It features a triazabicyclo framework, which contributes to its unique chemical properties. The presence of hydroxyl groups indicates potential for hydrogen bonding, influencing its solubility and reactivity. The multiple double bonds in the pentaene structure suggest that it may exhibit significant conjugation, potentially affecting its optical properties and reactivity in various chemical reactions. Additionally, the presence of methyl and isopropyl substituents may impact its steric hindrance and overall stability. This compound may be of interest in fields such as medicinal chemistry or materials science due to its structural complexity and potential biological activity. However, specific applications and biological effects would require further investigation and characterization.
Formula:C26H37N3O7
InChI:InChI=1/C26H37N3O7/c1-15(2)24-17(4)8-9-22(32)27-10-6-7-16(3)11-19(30)12-20(31)13-23-29-21(14-35-23)25(33)28-18(5)26(34)36-24/h6-9,11,14-15,17-20,24,30-31H,10,12-13H2,1-5H3,(H,27,32)(H,28,33)/b7-6+,9-8-,16-11+/t17-,18-,19-,20-,24-/m1/s1
Synonyms:- Madumycin I, 15-deoxo-15-hydroxy-, (15R)-
- Antibiotic A 2315A
- 6,23-Dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-9,14,16,22(25),24-pentaene-2,5,11-trione, 18,20-dihydroxy-4,8,16-trimethyl-7-(1-methylethyl)-, (4R,7R,8R,9E,14E,16E,18S,20R)-
- Madumicin II
- (4R,7R,8R,9E,14E,16E,18S,20R)-18,20-Dihydroxy-4,8,16-trimethyl-7-(1-methylethyl)-6,23-dioxa-3,12,25-triazabicyclo[20.2.1]pentacosa-9,14,16,22(25),24-pentaene-2,5,11-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
