CAS 58722-33-1

1-[4-(pyrrolidin-1-ylsulfonyl)phenyl]ethanone

Description:

1-[4-(Pyrrolidin-1-ylsulfonyl)phenyl]ethanone, with the CAS number 58722-33-1, is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with a pyrrolidinylsulfonyl group and an ethanone moiety. This compound typically exhibits properties associated with both sulfonamide and ketone functionalities, which can influence its reactivity and interactions in various chemical environments. It may be soluble in organic solvents, reflecting the presence of both hydrophobic and polar groups in its structure. The sulfonyl group can enhance the compound's ability to participate in nucleophilic reactions, while the ketone group may engage in electrophilic reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, 1-[4-(pyrrolidin-1-ylsulfonyl)phenyl]ethanone represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₂H₁₅NO₃S

InChI: InChI=1/C12H15NO3S/c1-10(14)11-4-6-12(7-5-11)17(15,16)13-8-2-3-9-13/h4-7H,2-3,8-9H2,1H3

SMILES: CC(=O)c1ccc(cc1)S(=O)(=O)N1CCCC1

Synonyms:

• 1-[4-(Pyrrolidine-1-sulfonyl)-phenyl]-ethanone
• Ethanone, 1-[4-(1-Pyrrolidinylsulfonyl)Phenyl]-

1-[4-(Pyrrolidine-1-sulfonyl)phenyl]ethan-1-one

CAS: 58722-33-1

Versatile small molecule scaffold

Formula: C₁₂H₁₅NO₃S

Purity: Min. 95%

Molecular weight: 253.32 g/mol

Ref: 3D-ICA72233