CymitQuimica logo

CAS 58733-41-8

:

benzoic acid, 2-bromo-5-methoxy-, ethyl ester

Description:
Benzoic acid, 2-bromo-5-methoxy-, ethyl ester, with the CAS number 58733-41-8, is an organic compound that belongs to the class of benzoic acid derivatives. This compound features a benzoic acid core substituted with a bromine atom at the 2-position and a methoxy group at the 5-position, along with an ethyl ester functional group. Its molecular structure contributes to its unique chemical properties, including moderate solubility in organic solvents and limited solubility in water due to the hydrophobic aromatic ring. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The methoxy group can also affect the compound's electronic properties and steric hindrance. Benzoic acid derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H11BrO3
InChI:InChI=1/C10H11BrO3/c1-3-14-10(12)8-6-7(13-2)4-5-9(8)11/h4-6H,3H2,1-2H3
SMILES:CCOC(=O)c1cc(ccc1Br)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.